| Identification | Back Directory | [Name]
Methotrimeprazine Sulfoxide | [CAS]
7606-29-3 | [Synonyms]
levomepromazine sulfoxide Methotrimeprazine Sulfoxide Levomeprozamine 5-Sulfoxide Methotrimeprazine 5-Sulfoxide Levomepromazine EP Impurity B rac MethotriMeprazine Sulfoxide 10-[(2R)-3-(Dimethylamino)-2-methyl Levomepromazine (Methotrimeprazine) EPImpurity B Levomepromazine Impurity 2(Levomepromazine EP Impurity B) 2-Methoxy-N,N,β-triMethyl-10H-phenothiazine-10-propanaMine 5-Oxide (R)-2-Methoxy-N,N,-trimethyl-5-oxide-10H-phenothiazine-10-propanamine (bR)-2-Methoxy-N,N,b-trimethyl-5-oxide-10H-phenothiazine-10-propanamine 10H-Phenothiazine-10-propanamine, 2-methoxy-N,N,β-trimethyl-, 5-oxide, (βR)- 10-[(2R)-3-(Dimethylamino)-2-methylpropyl]-2-methoxy-10H-phenothiazine 5- oxide | [Molecular Formula]
C19H24N2O2S | [MDL Number]
MFCD09752131 | [MOL File]
7606-29-3.mol | [Molecular Weight]
344.47 |
| Chemical Properties | Back Directory | [Boiling point ]
517.4±50.0 °C(Predicted) | [density ]
1.25±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [form ]
solid | [pka]
9.30±0.28(Predicted) | [Major Application]
pharmaceutical pharmaceutical small molecule | [InChI]
1S/C19H24N2O2S/c1-14(12-20(2)3)13-21-16-7-5-6-8-18(16)24(22)19-10-9-15(23-4)11-17(19)21/h5-11,14H,12-13H2,1-4H3 | [InChIKey]
CUJAZGOWDHBZEI-UHFFFAOYSA-N | [SMILES]
[S]1(=O)c2c(cc(cc2)OC)N(c3c1cccc3)CC(CN(C)C)C |
| Hazard Information | Back Directory | [Uses]
A metabolite of Methotrimeprazine (M260785). | [Uses]
Levomepromazine-d3 Sulfoxide is a labelled metabolite of Methotrimeprazine (M260785). |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|