| Identification | Back Directory | [Name]
4-(Bromomethyl)benzenesulfonyl fluoride | [CAS]
7612-88-6 | [Synonyms]
WWAPDVQUZYCNCR-UHFFFAOYSA-N
4-(Bromomethyl)benzenesulfonyl fluoride
Benzenesulfonyl fluoride, 4-(bromomethyl)-
4-(Bromomethyl)benzene-1-sulfonyl Fluoride
4-(Bromomethyl)benzenesulfonyl fluoride 97% | [Molecular Formula]
C7H6BrFO2S | [MDL Number]
MFCD28098665 | [MOL File]
7612-88-6.mol | [Molecular Weight]
253.09 |
| Chemical Properties | Back Directory | [Melting point ]
80-85°C | [Boiling point ]
287.7±23.0 °C(Predicted) | [density ]
1.691±0.06 g/cm3(Predicted) | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [form ]
solid | [InChI]
1S/C7H6BrFO2S/c8-5-6-1-3-7(4-2-6)12(9,10)11/h1-4H,5H2 | [InChIKey]
WWAPDVQUZYCNCR-UHFFFAOYSA-N | [SMILES]
O=S(C1=CC=C(CBr)C=C1)(F)=O |
| Safety Data | Back Directory | [Hazard Codes ]
C | [Risk Statements ]
34 | [Safety Statements ]
26-36/37/39-45 | [RIDADR ]
UN 3261 8 / PGII | [WGK Germany ]
3 | [Storage Class]
8A - Combustible corrosive hazardous materials | [Hazard Classifications]
Skin Corr. 1B |
| Hazard Information | Back Directory | [Uses]
4-(Bromomethyl)benzenesulfonyl fluoride (Fluorosulfonylbenzyl bromide) is an important chemical reagent with good biological activity. 4-(Bromomethyl)benzenesulfonyl fluoride can be used to prepare various bioactive molecules, especially in the process of compound discovery and synthesis, showing excellent reactivity. 4-(Bromomethyl)benzenesulfonyl fluoride is often used in the development of new biological agents, promoting the research progress of organic chemistry and biochemistry. | [reaction suitability]
reaction type: click chemistry |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Rhawn Reagent
|
| Telephone: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
https://www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
Nextpeptide Inc
|
| Telephone: |
+86-0571-81612335 +8613336028439 |
| Website: |
http://www.nextpeptide.com/ |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Energy Chemical
|
| Telephone: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|