| Identification | Back Directory | [Name]
(S)-tert-Butyl 3-(2-ethoxy-2-oxoethyl)morpholine-4-carboxylate | [CAS]
761460-04-2 | [Synonyms]
Ethyl (S)-4-N-BOC-MORPHOLINE-3-ACETATE (S)-tert-Butyl 3-(2-ethoxy-2-oxoethyl)morpholine-4-carboxylate Tert-butyl (3s)-3-(2-ethoxy-2-oxoethyl)morpholine-4-carboxylate (S)-3-Ethoxycarbonylmethyl-morpholine-4-carboxylic acid tert-butyl ester 3-Morpholineacetic acid, 4-[(1,1-dimethylethoxy)carbonyl]-, ethyl ester, (3S)- | [Molecular Formula]
C13H23NO5 | [MDL Number]
MFCD23701548 | [MOL File]
761460-04-2.mol | [Molecular Weight]
273.33 |
| Chemical Properties | Back Directory | [Boiling point ]
348.1±27.0 °C(Predicted) | [density ]
1.094±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [pka]
-2.31±0.40(Predicted) | [Appearance]
Colorless to light yellow Solid | [InChI]
InChI=1S/C13H23NO5/c1-5-18-11(15)8-10-9-17-7-6-14(10)12(16)19-13(2,3)4/h10H,5-9H2,1-4H3/t10-/m0/s1 | [InChIKey]
ZNKFBXONLAWNSJ-JTQLQIEISA-N | [SMILES]
N1(C(OC(C)(C)C)=O)CCOC[C@@H]1CC(OCC)=O |
| Hazard Information | Back Directory | [Uses]
(S)-tert-Butyl 3-(2-ethoxy-2-oxoethyl)morpholine-4-carboxylate is mainly used as a pharmaceutical intermediate and chiral synthetic building block, and is widely used in laboratory research and development and the chemical synthesis of complex drug molecules. |
|
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
Cool Pharm, Ltd
|
| Tel: |
021-58581007 18019463053 |
| Website: |
http://www.coolpharm.com.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|