| Identification | Back Directory | [Name]
3-Azetidinone, 1-[(4-methylphenyl)sulfonyl]- | [CAS]
76543-27-6 | [Synonyms]
1-Tosylazetidin-3-one 1-(4-methylbenzenesulfonyl)azetidin-3-one 1-[(4-Methylphenyl)sulfonyl]-3-azetidinone 3-Azetidinone, 1-[(4-methylphenyl)sulfonyl]- 1-[(4-Methylphenyl)sulfonyl]-3-azetidinone 95% | [Molecular Formula]
C10H11NO3S | [MDL Number]
MFCD00129860 | [MOL File]
76543-27-6.mol | [Molecular Weight]
225.26 |
| Chemical Properties | Back Directory | [Melting point ]
147-152°C | [Boiling point ]
395.4±52.0 °C(Predicted) | [density ]
1.389±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [form ]
powder | [pka]
-9.97±0.20(Predicted) | [Appearance]
White to light yellow Solid | [InChI]
1S/C10H11NO3S/c1-8-2-4-10(5-3-8)15(13,14)11-6-9(12)7-11/h2-5H,6-7H2,1H3 | [InChIKey]
YRVBXEVVGIQJOZ-UHFFFAOYSA-N | [SMILES]
O=C1CN(S(C2=CC=C(C)C=C2)(=O)=O)C1 |
| Hazard Information | Back Directory | [Chemical Properties]
White solid | [Uses]
1-Tosylazetidin-3-one is a useful synthetic intermediate. It is used to synthesize Azaspiro[3.3]heptanes as building blocks for medicinal chemistry. |
|
| Company Name: |
SynAsst Chemical.
|
| Tel: |
021-60343070 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15848/0_EN.htm |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Struchem Co., Ltd.
|
| Tel: |
0512-63009836 18994340901 |
| Website: |
www.beidapharma.com |
|