| Identification | Back Directory | [Name]
5-Methylquinoline | [CAS]
7661-55-4 | [Synonyms]
5-METHYLQUINOLINE
Quinoline, 5-methyl-
5-Methylquinoline ISO 9001：2015 REACH | [EINECS(EC#)]
231-630-6 | [Molecular Formula]
C10H9N | [MDL Number]
MFCD01685457 | [MOL File]
7661-55-4.mol | [Molecular Weight]
143.19 |
| Chemical Properties | Back Directory | [Melting point ]
19°C | [Boiling point ]
257.85°C | [density ]
1.0832 | [refractive index ]
1.6219 | [storage temp. ]
Sealed in dry,Room Temperature | [pka]
5.2(at 20℃) | [Appearance]
Brown to black Liquid | [InChI]
InChI=1S/C10H9N/c1-8-4-2-6-10-9(8)5-3-7-11-10/h2-7H,1H3 | [InChIKey]
LMYVCXSKCQSIEQ-UHFFFAOYSA-N | [SMILES]
N1C2C(=C(C)C=CC=2)C=CC=1 | [NIST Chemistry Reference]
Quinoline, 5-methyl-(7661-55-4) |
| Hazard Information | Back Directory | [Chemical Properties]
Colorless or light yellow oily liquid. The melting point is 19°C, the boiling point is 262.7°C, 129°C (2.0kPa), the relative density is 1.0830 (20/4°C), and the refractive index is 1.6219. It is miscible with ethanol and ether, soluble in benzene and slightly soluble in water. | [Uses]
5-Methylquinoline is used for the synthesis of photosensitizing dyes. | [Synthesis]
5-Methylquinoline can be prepared by reacting m-amino-p-toluonitrile, glycerol and m-nitrobenzene sulfonate in an acidic environment. |
|
| Company Name: |
Cool Pharm, Ltd
|
| Telephone: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
| Company Name: |
parabiochem
|
| Telephone: |
025-83453382-8005 |
| Website: |
www.parabiochem.cn |
|