| Identification | Back Directory | [Name]
caramiphen | [CAS]
77-22-5 | [Synonyms]
caramiphen caramiphen USP/EP/BP Pentaphen【pharmaceutical】 Pentoxyverine EP Impurity B Pentoxyverine impurity B CRS Pentoxyverine hydrogen citrate EP Impurity B 2-(Diethylamino)ethyl 1-phenylcyclopentanecarboxylate 1-(2-Diethylaminoethoxycarbonyl)-1-phenylcyclopentane 2-diethylaminoethyl 1-phenylcyclopentane-1-carboxylate 1-Phenyl-1-cyclopentanecarboxylic acid 2-(diethylamino)ethyl 1-phenylcyclopentanecarboxylic acid 2-diethylaminoethyl ester 1-Phenyl-1-cyclopentanecarboxylic acid 2-(diethylamino)ethyl ester Cyclopentanecarboxylic acid, 1-phenyl-, 2-(diethylamino)ethyl ester | [EINECS(EC#)]
201-013-6 | [Molecular Formula]
C18H27NO2 | [MOL File]
77-22-5.mol | [Molecular Weight]
289.416 |
| Chemical Properties | Back Directory | [Boiling point ]
bp0.07 112-115° | [storage temp. ]
2-8°C | [form ]
neat | [Major Application]
pharmaceutical (small molecule) | [InChI]
1S/C18H27NO2/c1-3-19(4-2)14-15-21-17(20)18(12-8-9-13-18)16-10-6-5-7-11-16/h5-7,10-11H,3-4,8-9,12-15H2,1-2H3 | [InChIKey]
OFAIGZWCDGNZGT-UHFFFAOYSA-N | [SMILES]
N(CCOC(=O)C2(CCCC2)c1ccccc1)(CC)CC |
| Hazard Information | Back Directory | [Chemical Properties]
Liquid. Boiling point: 156-158°C (0.93 kPa), 110-115°C (6.65×10-3 kPa). | [Uses]
Pentoxyverine impurity B EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. | [Definition]
ChEBI: Caramiphen is a member of benzenes. | [Synthesis Reference(s)]
Canadian Journal of Chemistry, 40, p. 1909, 1962 DOI: 10.1139/v62-293 |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
|