| Identification | Back Directory | [Name]
(2-AMINOBENZYL)TRIPHENYLPHOSPHONIUM BROMIDE | [CAS]
78133-84-3 | [Synonyms]
(2-aminophenyl)methyl-triphenylphosphanium (2-AMINOBENZYL)TRIPHENYLPHOSPHONIUM BROMIDE (2-Aminobenzyl)triphenylphosphonium bromide 97% (2-aminophenyl)methyl]triphenylphosphanium bromide | [Molecular Formula]
C25H23BrNP | [MDL Number]
MFCD00066987 | [MOL File]
78133-84-3.mol | [Molecular Weight]
448.33 |
| Chemical Properties | Back Directory | [Melting point ]
245 °C (dec.)(lit.) | [InChI]
1S/C25H23NP.BrH/c26-25-19-11-10-12-21(25)20-27(22-13-4-1-5-14-22,23-15-6-2-7-16-23)24-17-8-3-9-18-24;/h1-19H,20,26H2;1H/q+1;/p-1 | [InChIKey]
FBTZMAUPYYNVPM-UHFFFAOYSA-M | [SMILES]
[Br-].Nc1ccccc1C[P+](c2ccccc2)(c3ccccc3)c4ccccc4 |
| Hazard Information | Back Directory | [Uses]
Reactant for:
- Intramolecular Wittig reaction
- Preparation of 2,3-disubstituted indoles
- Preparation of pyrrolocarbazoles as poly(ADP-ribose) polymerase-1 (PARP-1) inhibitors
| [reaction suitability]
reaction type: C-C Bond Formation |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|