| Identification | Back Directory | [Name]
1-(4-PIPERIDYL)-1H-1,2,3-BENZOTRIAZOLE HYDROCHLORIDE | [CAS]
79098-80-9 | [Synonyms]
BUTTPARK 93\04-11 4-BENZOTRIAZOL-1-YLPIPERIDINE HYDROCHLORIDE 1-(4-Piperidyl)-(1H)-1,2,3-benzotriazoleHCl 1-(4-piperidinyl)benzotriazole hydrochloride 4-(1H-Benzotriazol-1-yl)piperidine hydrochloride 1-(Piperidin-4-yl)-1H-benzotriazole hydrochloride 1-(4-PIPERIDYL)-1H-1,2,3-BENZOTRIAZOLE HYDROCHLORIDE 1-Piperidin-4-yl-1H-1,2,3-benzotriazole hydrochloride 1-(4-Piperidyl)-1H-1,2,3-benzotriazole hydrochloride, 90+% 1-(Piperidin-4-yl)-1H-benzo[d][1,2,3]triazole hydrochloride | [Molecular Formula]
C11H15ClN4 | [MDL Number]
MFCD00831110 | [MOL File]
79098-80-9.mol | [Molecular Weight]
238.72 |
| Chemical Properties | Back Directory | [Melting point ]
314 °C | [storage temp. ]
Store at room temperature, keep dry and cool | [form ]
solid | [Appearance]
White to off-white Solid | [InChI]
1S/C11H14N4.ClH/c1-2-4-11-10(3-1)13-14-15(11)9-5-7-12-8-6-9;/h1-4,9,12H,5-8H2;1H | [InChIKey]
SIZIQJKLJZWLLD-UHFFFAOYSA-N | [SMILES]
C1(N2N=NC3=CC=CC=C32)CCNCC1.Cl |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
CHEMSWORTH
|
| Tel: |
+91-261-2397244 |
| Website: |
www.chemsworth.com |
| Company Name: |
Matrix Scientific
|
| Tel: |
803 788-9494 All other calls |
| Website: |
www.matrixscientific.com |
|