| Identification | Back Directory | [Name]
KEMP'S TRIACID | [CAS]
79410-20-1 | [Synonyms]
KEMP'S TRIACID 1,3,5-Trimethylcyclohexane-1β,3β,5β-tricarboxylic acid Aluminum oxide, fused, #200+325 mesh, 99+% metals basis cis,cis-1,3,5-trime.cyclohexane-1,3,5-tricarboxylic acid cis,cis-1,3,5-Trimethyl-1,3,5-cyclohexanetricarboxylic acid CIS,CIS-1,3,5-TRIMETHYLCYCLOHEXANE-1,3,5-TRICARBOXYLIC ACID 1,3,5-Trimethyl-1,3,5-cyclohexanetricarboxylicacid(Kemp'striacid) cis,cis-1,3,5-Trimethyl-1,3,5-cyclohexanetricarboxylic acid (Kemp''s triacid) | [Molecular Formula]
C12H18O6 | [MDL Number]
MFCD00075251 | [MOL File]
79410-20-1.mol | [Molecular Weight]
258.27 |
| Chemical Properties | Back Directory | [Melting point ]
241-243 °C(lit.)
| [Boiling point ]
364.0±42.0 °C(Predicted) | [density ]
1.301±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [pka]
4.02±0.50(Predicted) | [BRN ]
3557263 | [InChI]
1S/C12H18O6/c1-10(7(13)14)4-11(2,8(15)16)6-12(3,5-10)9(17)18/h4-6H2,1-3H3,(H,13,14)(H,15,16)(H,17,18)/t10-,11+,12- | [InChIKey]
AZWHPGZNOIYGFB-ZSBIGDGJSA-N | [SMILES]
C[C@@]1(C[C@](C)(C[C@](C)(C1)C(O)=O)C(O)=O)C(O)=O | [CAS DataBase Reference]
79410-20-1 |
| Hazard Information | Back Directory | [Uses]
Versatile molecule for molecular recognition studies. Also used to prepare a chiral auxiliary for asymmetric radical addition, allylation, and annulation reactions. | [Purification Methods]
Recrystallise the tricarboxylic acid from Me2CO after re-precipitating it several times with mineral acid from aqueous alkaline soltion. The trimethyl ester has m 78-81o. [cf. Kemp J Org Chem 46 5140 1981, Jeong et al. J Am Chem Soc 113 201 1991, Stack et al. J Am Chem Soc 114 7007 1992.] |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
Fulcrum Scientific Ltd.
|
| Tel: |
+44 1484 317 214 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList702/0_EN.htm |
|