| Identification | Back Directory | [Name]
2,2',2''-(benzene-1,3,5-triyl)triacetonitrile | [CAS]
80935-59-7 | [Synonyms]
BZ095 1,3,5-Benzenetriacetonitrile (benzene-1,3,5-triyl)triacetonitrile 2,2',2''-(benzene-1,3,5-triyl)triacetonitrile | [Molecular Formula]
C12H9N3 | [MDL Number]
MFCD30491308 | [MOL File]
80935-59-7.mol | [Molecular Weight]
195.22 |
| Chemical Properties | Back Directory | [Melting point ]
123-125 °C | [Boiling point ]
429.0±40.0 °C(Predicted) | [density ]
1.161±0.06 g/cm3(Predicted) | [storage temp. ]
Storage temp. 2-8°C | [Appearance]
Off-white to light yellow Solid | [InChI]
InChI=1S/C12H9N3/c13-4-1-10-7-11(2-5-14)9-12(8-10)3-6-15/h7-9H,1-3H2 | [InChIKey]
QEIMSNKURDQYSE-UHFFFAOYSA-N | [SMILES]
C1(CC#N)=CC(CC#N)=CC(CC#N)=C1 |
| Hazard Information | Back Directory | [Uses]
2,2',2''-(Benzene-1,3,5-triyl)triacetonitrile is used as a monomer for the synthesis of COF materials: GS-COF-1; supramolecular organic framework (SOF). |
|
| Company Name: |
Rhawn Reagent
|
| Telephone: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
|