| Identification | Back Directory | [Name]
5'-O-(4,4'-DIMETHOXYTRITYL)ADENOSINE | [CAS]
81352-25-2 | [Synonyms]
5'-DMT-rA 5'-O-DMT-adenosine 5'-O-dimethoxytrityladenosine 5'-O-(4,4'-DIMETHOXYTRITYL)ADENOSINE 5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-adenosine Adenosine, 5'-O-[bis(4-Methoxyphenyl)phenylMethyl]- (2R,3R,4S,5R)-2-(6-amino-9H-purin-9-yl)-5-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)tetrahydrofuran-3,4-diol | [Molecular Formula]
C31H31N5O6 | [MDL Number]
MFCD00057878 | [MOL File]
81352-25-2.mol | [Molecular Weight]
569.61 |
| Chemical Properties | Back Directory | [Melting point ]
145-147 °C | [Boiling point ]
812.0±75.0 °C(Predicted) | [density ]
1.40±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C(protect from light) | [form ]
Solid | [pka]
13.08±0.70(Predicted) | [color ]
White to off-white | [InChIKey]
KOQFCLKBHJBRTB-WMPYGVGNNA-N | [SMILES]
O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C3=C(C(=NC=N3)N)N=C2)[C@H](O)[C@@H]1O |&1:25,27,38,40,r| |
| Hazard Information | Back Directory | [Uses]
5''-O-[Bis(4-methoxyphenyl)phenylmethyl]-adenosine is an oligonucleotide used in the synthesis of oligonucleotides carrying fluorescently labeled O6-alkylguanine for measuring hAGT activity. |
|
| Company Name: |
T&W GROUP
|
| Telephone: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Finetech Industry Limited
|
| Telephone: |
+86-27-8746-5837 +86-18627785180 |
| Website: |
https://www.finetechnology-ind.com/ |
| Company Name: |
NewCan Biotech Limited
|
| Telephone: |
+86-571-86912261 19975279805 |
| Website: |
https://www.newcanbio.com/ |
|