| Identification | Back Directory | [Name]
4,4′-Bis(3,6-di-tert-butyl-9H-carbazol-9-yl)-1,1′-biphenyl | [CAS]
838862-47-8 | [Synonyms]
4,4′-Bis(3,6-di-tert-butyl-9H-carbazol-9-yl)-1,1′-biphenyl
9,9′-[1,1′-Biphenyl]-4,4′-diylbis[3,6-bis(1,1-dimethyl ethyl)]-9H-carbazole
9H-Carbazole, 9,9'-[1,1'-biphenyl]-4,4'-diylbis[3,6-bis(1,1-dimethylethyl)-
4,4'-Bis(3,6-di-tert-butyl-9H-carbazol-9-yl)-1,1'-biphenyl (This product is unavailable in the U.S.) | [Molecular Formula]
C52H56N2 | [MDL Number]
MFCD31692924 | [MOL File]
838862-47-8.mol | [Molecular Weight]
709.01 |
| Chemical Properties | Back Directory | [Melting point ]
437-442°C | [Boiling point ]
796.0±60.0 °C(Predicted) | [density ]
1.05±0.1 g/cm3(Predicted) | [storage temp. ]
Store at room temperature | [form ]
solid | [Appearance]
Off-white to gray Solid | [InChIKey]
OFUWRAFMFGLINE-UHFFFAOYSA-N | [SMILES]
CC(C)(C)c1ccc2n(-c3ccc(cc3)-c4ccc(cc4)-n5c6ccc(cc6c7cc(ccc57)C(C)(C)C)C(C)(C)C)c8ccc(cc8c2c1)C(C)(C)C |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|