| Identification | Back Directory | [Name]
Di-Mu-chlorobis(2'-aMino-1,1'-biphenyl-2-yl-C,N)dipalladiuM(II) | [CAS]
847616-85-7 | [Synonyms]
-biphenyl]-2-yl-C]dipalladium(II) Bis[2′-(amino-κN)[1,1′-biphenyl]-2-yl-κ -biphenyl-2-yl)palladium(II) dimer, min. 98% Chloro(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) diMer Chloro(2'-amino-1,1'-biphenyl-2-yl)palladium(II)dimer,min.98% Di-μ-chlorobis(2'-aMino-1,1'-biphenyl-2-yl-C,N)dipalladiuM(II) Di-Mu-chlorobis(2'-aMino-1,1'-biphenyl-2-yl-C,N)dipalladiuM(II) Chloro(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) diMer, Min. 98% Di-μ-chlorobis[2′-(amino-N)[1,1′-biphenyl]-2-yl-C]dipalladium(II) Di-Mu-chlorobis[2'-(aMino-N)[1,1'-biphenyl]-2-yl-C]dipalladiuM(II) Di-mu-chlorobis(2'-amino-1,1'-biphenyl-2-yl-C,N)dipalladium(II)> | [Molecular Formula]
C24H20Cl2N2Pd2 | [MDL Number]
MFCD22200542 | [MOL File]
847616-85-7.mol | [Molecular Weight]
618.16 |
| Chemical Properties | Back Directory | [Melting point ]
207°C(lit.) | [form ]
Powder | [color ]
pale gray | [Sensitive ]
air sensitive | [InChI]
InChI=1S/2C12H9N.2ClH.2Pd/c2*13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;;;;/h2*1-6,8-9,13H;2*1H;;/q2*-2;;;2*+3/p-2 | [InChIKey]
FULOGHIJKOYUOO-UHFFFAOYSA-L | [SMILES]
[Pd+2]12(NC3=CC=CC=C3C3=CC=CC=[C-]13)[Cl-][Pd+2]1(NC3=CC=CC=C3C3=CC=CC=[C-]13)[Cl-]2 | [CAS DataBase Reference]
847616-85-7 |
| Hazard Information | Back Directory | [Uses]
Di-μ-chlorobis(2''-amino-1,1''-biphenyl-2-yl-C,N)dipalladium(II) (CAS# 847616-85-7) is an organometallic catalyst for α-arylations of methyl sulfones with aryl chlorIdes, and for cross-coupling reactions of aromatic boronic acids and acyl chlorides. | [reaction suitability]
core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|