| Identification | Back Directory | [Name]
2-(4-FLUOROPHENYL)-5-METHYLPYRIDINE | [CAS]
85237-65-6 | [Synonyms]
F-mppy F-mppyH p-F(Me)ppy Einecs 286-425-4 2-(4-FLUOROPHENYL)-5-METHYLPYRIDINE 5-Methyl-2-(4-fluorophenyl)pyridine Pyridine, 2-(4-fluorophenyl)-5-methyl- 2-(4-Fluorophenyl)-5-methylpyridine, min. 97% | [EINECS(EC#)]
286-425-4 | [Molecular Formula]
C12H10FN | [MDL Number]
MFCD09037512 | [MOL File]
85237-65-6.mol | [Molecular Weight]
187.21 |
| Chemical Properties | Back Directory | [Melting point ]
58-59 °C | [Boiling point ]
285.6±25.0 °C(Predicted) | [density ]
1.111±0.06 g/cm3(Predicted) | [storage temp. ]
Store at room temperature | [form ]
powder or crystals | [pka]
4.80±0.25(Predicted) | [Appearance]
White to off-white Solid | [InChI]
InChI=1S/C12H10FN/c1-9-2-7-12(14-8-9)10-3-5-11(13)6-4-10/h2-8H,1H3 | [InChIKey]
WSVYYUKIXFSDTE-UHFFFAOYSA-N | [SMILES]
C1(C2=CC=C(F)C=C2)=NC=C(C)C=C1 |
| Hazard Information | Back Directory | [Uses]
2-(4-Fluorophenyl)-5-methylpyridine is a ligand used for the preparation of Ir(III) photocatalysts. | [reaction suitability]
reaction type: Photocatalysis reagent type: catalyst |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
DebyeTec.com Inc.
|
| Tel: |
18086626237 18086626237 |
| Website: |
www.chemicalbook.com/showsupplierproductslist16955/0.htm |
| Company Name: |
Domole Scientific
|
| Tel: |
13275595566; 13275595566 |
| Website: |
http://www.domole.com/ |
|