| Identification | Back Directory | [Name]
AMMONIUM-15N ACETATE | [CAS]
86451-35-6 | [Synonyms]
AMMONIUM-15N ACETATE AMMONIUM ACETATE (15N) 98 atom % 15N AMMONIUM-15N ACETATE, 99 ATOM % 15N | [Molecular Formula]
C2H7NO2 | [MDL Number]
MFCD00084192 | [MOL File]
86451-35-6.mol | [Molecular Weight]
78.09 |
| Chemical Properties | Back Directory | [Melting point ]
110-112 °C (dec.)(lit.) | [form ]
solid | [InChI]
1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3/i;1+1 | [InChIKey]
USFZMSVCRYTOJT-IEOVAKBOSA-N | [SMILES]
CC([O-])=O.[H][15N+]([H])([H])[H] | [CAS Number Unlabeled]
631-61-8 |
| Hazard Information | Back Directory | [Uses]
Ammonium-15N Acetate is 15N isotope labelled Ammonium Acetate (A633900), which is a versatile reagent, often used with acetic acid to create a buffer solution. It acts as a catalyst in the Knoevenagel condensation. Ammonium acetate is also used as a food additive as an acidity regulator. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|