| Identification | Back Directory | [Name]
Fmoc-Glu(OtBu)-Gly-OH | [CAS]
866044-63-5 | [Synonyms]
Fmoc-Glu(OtBu)-Gly
Fmoc-Glu(OtBu)-Gly-OH
Glycine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-α-glutamyl-, 1-(1,1-dimethylethyl) ester
2-[(2S)-5-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-oxopentanamido]acetic acid | [Molecular Formula]
C26H30N2O7 | [MDL Number]
MFCD30475796 | [MOL File]
866044-63-5.mol | [Molecular Weight]
482.53 |
| Chemical Properties | Back Directory | [Boiling point ]
748.2±60.0 °C(Predicted) | [density ]
1?+-.0.06 g/cm3(Predicted) | [form ]
Solid | [pka]
3.34±0.10(Predicted) | [InChIKey]
PLLNQUBUIXIMLG-DLINEHSKNA-N | [SMILES]
C(C1C2=CC=CC=C2C2=CC=CC=C12)OC(=O)N[C@H](C(=O)NCC(=O)O)CCC(=O)OC(C)(C)C |&1:18,r| |
| Hazard Information | Back Directory | [Description]
Fmoc-Glu(OtBu)-OH is the glutamic acid deriviative used most often in solid phase peptide synthesis.
| [Uses]
Fmoc-Glu(OtBu)-Gly-OH serves as a building block in the synthesis of peptides. It can be coupled with other amino acid residues to construct peptides with desired sequences. The Fmoc group acts as a protective group, allowing for selective deprotection and subsequent coupling reactions during solid-phase peptide synthesis.
| [Definition]
Fmoc-Glu(OtBu)-Gly-OH is a small molecule polypeptide composed of two amino acids, with the amino group of the polypeptide being blocked.
|
|
|