| Identification | Back Directory | [Name]
869-09-0 | [CAS]
869-09-0 | [Synonyms]
Dimethyl 2,4-dibromopentanedioate 1,5-dimethyl 2,4-dibromopentanedioate Pentanedioic acid, 2,4-dibromo-, dimethyl ester Pentanedioic acid, 2,4-dibromo-, 1,5-dimethyl ester 2,4-Dibromo-Pentanedioic Acid Dimethyl Ester(WX630083) | [Molecular Formula]
C7H10Br2O4 | [MOL File]
869-09-0.mol | [Molecular Weight]
317.96 |
| Chemical Properties | Back Directory | [Melting point ]
45 °C | [Boiling point ]
151-153 °C(Press: 11 Torr) | [density ]
1.7612 g/cm3 | [storage temp. ]
Sealed in dry,Room Temperature | [Appearance]
Pink to red Liquid | [InChI]
InChI=1S/C7H10Br2O4/c1-12-6(10)4(8)3-5(9)7(11)13-2/h4-5H,3H2,1-2H3 | [InChIKey]
ZBBXTTCCOXKVJB-UHFFFAOYSA-N | [SMILES]
C(OC)(=O)C(Br)CC(Br)C(OC)=O |
| Hazard Information | Back Directory | [Synthesis]
The general procedure for the synthesis of dimethyl cis-azetidine-2,4-dicarboxylate (CAS:31358-13-1) from 2,4-dibromopentanedioic acid is as follows:
Example 3: Preparation of dimethyl cis-azetidine-2,4-dicarboxylate
1. 1.14 g (3.93 mmol) of 2,4-dibromopentanedioic acid, 1 mL of methanol, 1.2 mL of carbon tetrachloride (CCl4), and 1 drop of concentrated hydrochloric acid were mixed.
2. The reaction mixture was refluxed in the presence of sulfuric acid for 8 hours.
3. Upon completion of the reaction, an aqueous post-treatment is performed: extraction with dichloromethane (CH2Cl2) and saturated sodium bicarbonate (NaHCO3) solution.
4. The organic phase was filtered through a silica gel column and the solvent was evaporated to give 0.87 g (70% yield) of dimethyl 2,4-dibromoglutarate.
Product characterization data:
1H NMR (CDCl3): δ 3.82 (s, 6H); dl-isomer: δ 4.53 (dd, 2H, J = 6.5, 8 Hz), 2.68 (dd, 2H, J = 6.5, 8 Hz); endo isomer: δ 4.41 (t, 2H, J = 7.5 Hz), 2.89 (dt, 1H, J = 7.5 (t), 14.5 (d Hz), 2.64 (dt, 1H, J = 7.5(t), 14.5(d)Hz); dl/meso = 3:1.
IR (neat, cm-1): 3004, 2955, 1740, 1437, 1300, 1267, 1215, 1156, 851. | [References]
[1] Patent: US4946839, 1990, A [2] Patent: US4990504, 1991, A |
|
| Company Name: |
Wuxi AppTec
|
| Tel: |
022-59987777 13552403979 |
| Website: |
www.labnetwork.com |
|