| Identification | Back Directory | [Name]
bisMPA dendron | [CAS]
873849-89-9 | [Synonyms]
Polyester bis-MPA dendron, 8 hydroxyl, 1 azide | [Molecular Formula]
C41H69N3O22 | [MDL Number]
MFCD18426574 | [MOL File]
873849-89-9.mol | [Molecular Weight]
956 |
| Chemical Properties | Back Directory | [Melting point ]
114-119°C | [storage temp. ]
-20°C | [form ]
solid | [InChIKey]
RHUOETMPCLTKIU-UHFFFAOYSA-N | [SMILES]
CC(CO)(CO)C(=O)OCC(C)(COC(=O)C(C)(CO)CO)C(=O)OCC(C)(COC(=O)C(C)(COC(=O)C(C)(CO)CO)COC(=O)C(C)(CO)CO)C(=O)OCCCCCCN=[N+]=[N-] |
| Hazard Information | Back Directory | [Uses]
Azide dendrons can be coupled to acetylene functionalized molecules, including acetylene dendrons to form asymmetric dendrimers. | [General Description]
calculated mol. wt. 956 |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|