| Identification | Back Directory | [Name]
5-Thiazolamine, 2-methyl- | [CAS]
89281-44-7 | [Synonyms]
2-Methyl-5-aMinothiazole 5-Amino-2-methylthiazole 5-Thiazolamine, 2-methyl- 2-methyl-1,3-thiazol-5-amine | [Molecular Formula]
C4H6N2S | [MDL Number]
MFCD11847087 | [MOL File]
89281-44-7.mol | [Molecular Weight]
114.17 |
| Chemical Properties | Back Directory | [Boiling point ]
229.1±13.0 °C(Predicted) | [density ]
1.258±0.06 g/cm3(Predicted) | [storage temp. ]
Keep in dark place,Sealed in dry,2-8°C | [pka]
4.72±0.10(Predicted) | [Appearance]
Light yellow to brown Solid | [InChI]
InChI=1S/C4H6N2S/c1-3-6-2-4(5)7-3/h2H,5H2,1H3 | [InChIKey]
IDSUZAVUCMIBBS-UHFFFAOYSA-N | [SMILES]
S1C(N)=CN=C1C |
| Hazard Information | Back Directory | [Synthesis]
1. Acetaldehyde reacts with a cyanosilane in methanolic ammonia to give intermediate a1 (likely an aminonitrile). 2. Ethyl chloroacetate reacts with sulfur and triethylamine, then with bromoethane to yield intermediate b1 (likely a thioester). 3. b1 |
|
| Company Name: |
SAKEM LLP
|
| Tel: |
+91-9676889998 +91-9676889998 |
| Website: |
www.sakem.co.in |
|