| Identification | Back Directory | [Name]
3-AMINO-4-METHYL-PYRIDAZINE | [CAS]
90568-15-3 | [Synonyms]
4-methyl-3-Pyridazinamine 3-Pyridazinamine, 4-methyl- 3-AMINO-4-METHYL-PYRIDAZINE 3-AMINO-4-METHYL-PYRIDAZINE ISO 9001:2015 REACH | [Molecular Formula]
C5H7N3 | [MDL Number]
MFCD08460975 | [MOL File]
90568-15-3.mol | [Molecular Weight]
109.13 |
| Chemical Properties | Back Directory | [Melting point ]
193.5 °C | [Boiling point ]
316.8±22.0 °C(Predicted) | [density ]
1.155±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C(protect from light) | [pka]
5.31±0.10(Predicted) | [InChI]
InChI=1S/C5H7N3/c1-4-2-3-7-8-5(4)6/h2-3H,1H3,(H2,6,8) | [InChIKey]
WDTVJTBXOFGSJT-UHFFFAOYSA-N | [SMILES]
C1(N)=NN=CC=C1C |
| Hazard Information | Back Directory | [Uses]
3-Amino-4-methyl-pyridazine is a reactant used in the synthesis of antiinflammatory agents such as 2-?phenylimidazo[1,?2-?b]?pyridazine-?3-?acetic acid. |
|
| Company Name: |
Tetranov Biopharm
|
| Tel: |
13526569071 |
| Website: |
http://www.leadmedpharm.com/index.html |
|