| Identification | Back Directory | [Name]
SODIUM CARBONATE-13C | [CAS]
93673-48-4 | [Synonyms]
Soda ash-13C
Calcined soda-13C
SODIUM CARBONATE-13C
99 atom % 13C
13C Labeled sodium carbonate
Carbonic acid disodium salt-13C
SODIUM CARBONATE-13C, 99 ATOM % 13C | [Molecular Formula]
CNa2O3 | [MDL Number]
MFCD00148872 | [MOL File]
93673-48-4.mol | [Molecular Weight]
107 |
| Questions And Answer | Back Directory | [Preparation]
Sodium carbonate-13C is typically synthesized from carbon dioxide or carbonates enriched with carbon-13 via chemical synthesis routes. For example, carbon-13 carbon dioxide is reacted with sodium hydroxide to produce sodium carbonate-13C. |
| Chemical Properties | Back Directory | [Melting point ]
851 °C (lit.) | [form ]
powder | [InChI]
InChI=1S/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2/i1+1;; | [InChIKey]
CDBYLPFSWZWCQE-GOCMCNPZSA-L | [SMILES]
[13C]([O-])([O-])=O.[Na+].[Na+] | [CAS Number Unlabeled]
497-19-8 |
| Hazard Information | Back Directory | [Uses]
Sodium carbonate-13C is primarily used in scientific research and technological development. In chemical research, it serves as an isotope label to help trace chemical reaction pathways or study molecular dynamics. In environmental science, it can be used to analyze carbon cycle processes, such as simulating the absorption and release of carbon dioxide through labeling experiments. In industry, it is sometimes used as an internal standard to calibrate analytical instruments and ensure measurement accuracy. |
|
| Company Name: |
Suzhou Gold
|
| Telephone: |
18962320327 |
| Website: |
www.sc-iso.org/home |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Rhawn Reagent
|
| Telephone: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|