| Identification | Back Directory | [Name]
ADENOSINE 5'-O-THIOMONOPHOSPHATE | [CAS]
93839-85-1 | [Synonyms]
5'-amps adenosine5’-o-thiomonophosphate*dilithium adenosine-5’-monophosphorothioate(5’-amps),sodiumsalt Adenosine 5'-thiophosphoric acid O-lithium S-lithium salt Adenosine, 5'-(dihydrogen phosphorothioate), dilithium salt | [EINECS(EC#)]
298-858-6 | [Molecular Formula]
C10H12Li2N5O6PS | [MDL Number]
MFCD00042996 | [MOL File]
93839-85-1.mol | [Molecular Weight]
375.153 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [form ]
powder | [InChIKey]
FZXPFDFAEUBVHA-IDIVVRGQSA-L | [SMILES]
[Li+].[Li]SP([O-])(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3c(N)ncnc23 |
| Hazard Information | Back Directory | [Uses]
Adenosine 5′′-O-thiomonophosphate (5′-AMPS) is a 5′-O-thiophosphate which along with adenosine 5′-O-(2-thiodiphosphate) and adenosine 5′-O-(3-thiotriphosphate) can act as inhibitors of phosphohydrolases. AMPS is a substrate for smooth muscle endothelial ecto-5′-nucleotidase. 5′APMS is a stimulator of 5-lipoxygenase activity of rat polymorphonuclear (PMN) leukocytes. Histidine triad nucleotide-binding protein 1 (HINT-1) phosphoramidase transforms nucleoside 5′-O-phosphorothioates such as 5′-AMPS to nucleoside 5′-O-phosphates. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Enzo Biochem Inc
|
| Tel: |
Enzo Biochem Inc. 13797054060 |
| Website: |
www.enzo.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|