| Identification | Back Directory | [Name]
2,4,5-TRICHLOROPHENOL-3,6-D2 | [CAS]
93951-82-7 | [Synonyms]
2,4,5-Trichlorophenol-d2 2,4,5-TRICHLOROPHENOL-3,6-D2 2,4,5-TRICHLOROPHENOL (RING-D2) | [Molecular Formula]
C6HCl3D2O | [MDL Number]
MFCD00142806 | [MOL File]
93951-82-7.mol | [Molecular Weight]
199.46 |
| Chemical Properties | Back Directory | [Melting point ]
67-69 °C(lit.) | [Boiling point ]
248 °C/740 mmHg(lit.) | [Fp ]
133 °C | [solubility ]
Chloroform (Slightly), Methanol (Slightly) | [form ]
Solid | [color ]
White to Off-White | [InChI]
1S/C6H3Cl3O/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H/i1D,2D | [InChIKey]
LHJGJYXLEPZJPM-QDNHWIQGSA-N | [SMILES]
[2H]c1c(O)c(Cl)c([2H])c(Cl)c1Cl | [CAS Number Unlabeled]
95-95-4 |
| Hazard Information | Back Directory | [Uses]
2,4,5-Trichlorophenol-d2 is the labelled analogue of 2,4,5-Trichlorophenol (T774145), which is used as a broad range pesticide against insects, fungi, vegetation and bacteria. It has become a common environmental contaminant and probable human carcinogen. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
ChemService Inc.
|
| Tel: |
(800) 452-9994 Orders Only |
| Website: |
www.chemservice.com |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
Medical Isotopes
|
| Tel: |
1-(603) 635-1722 |
| Website: |
www.medicalisotopes.com |
|