| Identification | Back Directory | [Name]
KWD 2066 | [CAS]
96948-64-0 | [Synonyms]
KWD 2066 Salbutamol EP Imp B t-Butylnorsynephrine Albuterol EP Impurity B Salbutamol EP Impurity B 4-[2-(tert-Butylamino)-1-hydroxyethyl]phenol 2-tert-Butylamino-1-(4-hydroxyphenyl)ethanol Salbutamol Impurity 2(Salbutamol EP Impurity B) 4-{1-Hydroxy-2-[(2-methyl-2-propanyl)amino]ethyl}phenol (1RS)-2-[(1,1-Dimethylethyl)-amino]-1-(4-hydroxyphenyl)ethano Benzenemethanol, α-[[(1,1-dimethylethyl)amino]methyl]-4-hydroxy- Imp. B (EP):(1RS)-2-[(1,1-Dimethylethyl)-amino]-1-(4-hydroxyphenyl)ethano Salbutamol EP Impurity B (Salbutamol Deshydroxymethyl Impurity/ t-Butylnorsynephrine) | [Molecular Formula]
C12H19NO2 | [MDL Number]
MFCD01732936 | [MOL File]
96948-64-0.mol | [Molecular Weight]
209.28 |
| Chemical Properties | Back Directory | [Melting point ]
172-173.5 °C | [Boiling point ]
361.8±27.0 °C(Predicted) | [density ]
1.079±0.06 g/cm3(Predicted) | [storage temp. ]
Hygroscopic, Refrigerator, under inert atmosphere | [solubility ]
DMSO (Slightly), Methanol (Slightly) | [form ]
neat | [pka]
9.97±0.26(Predicted) | [color ]
Off-White | [Stability:]
Hygroscopic | [Major Application]
pharmaceutical pharmaceutical small molecule | [InChI]
1S/C12H19NO2/c1-12(2,3)13-8-11(15)9-4-6-10(14)7-5-9/h4-7,11,13-15H,8H2,1-3H3 | [InChIKey]
JOGFUYPGDLRKHD-UHFFFAOYSA-N | [SMILES]
N(C(C)(C)C)CC(O)c1ccc(cc1)O |
| Hazard Information | Back Directory | [Uses]
t-Butylnorsynephrine is a derivative of norsynephrine, an endogenous biogenic amine that is closely related to norepinephrine, which has effects on the adrenergic and dopaminergic system. Structure and activity tudies have shown that t-Butylnorsynephrine may also exhibit effects towards β-adrenergic receptors and β-adrenergic receptor-coupled adenylate cyclase. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
|