| Identification | Back Directory | [Name]
1,3-dibromo-2-(2,6-dibromophenyl)benzene | [CAS]
97038-96-5 | [Synonyms]
2,2',6,6'-Tetrabromo-1,1'-biphenyl 1,1'-Biphenyl, 2,2',6,6'-tetrabromo- 1,3-dibromo-2-(2,6-dibromophenyl)benzene | [Molecular Formula]
C12H6Br4 | [MDL Number]
MFCD30474847 | [MOL File]
97038-96-5.mol | [Molecular Weight]
469.79 |
| Chemical Properties | Back Directory | [Melting point ]
215 °C(Solv: ethanol (64-17-5); ethyl ether (60-29-7)) | [Boiling point ]
391.3±37.0 °C(Predicted) | [density ]
2.140±0.06 g/cm3(Predicted) | [InChI]
InChI=1S/C12H6Br4/c13-7-3-1-4-8(14)11(7)12-9(15)5-2-6-10(12)16/h1-6H | [InChIKey]
RAIZQBVLCDNAOH-UHFFFAOYSA-N | [SMILES]
C1(C2=C(Br)C=CC=C2Br)=C(Br)C=CC=C1Br |
| Hazard Information | Back Directory | [Uses]
2,2'',6,6''-Tetrabromo-1,1''-biphenyl is a research intermediate used in the preparation of triphenylenes, tetraphenylenes, and other related compound. |
|
| Company Name: |
Henan Alfachem Co.,Ltd. Gold
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
Tetranov Biopharm
|
| Tel: |
13526569071 |
| Website: |
www.leadmedpharm.com/index.html |
| Company Name: |
SunaTech Inc.
|
| Tel: |
0512-62872180 18994314770 |
| Website: |
http://www.sunatech.com.cn/ |
|