| Identification | Back Directory | [Name]
(E,Z)-2,13-OCTADECADIENAL | [CAS]
99577-57-8 | [Synonyms]
Koiganal II 2E13Z-18CHO octadeca-2,13-dienal (2E,13Z)-Octadecadienal (E,Z)-2,13-OCTADECADIENAL (2E,13Z)-2,13-Octadecadienal trans-2,cis-13-Octadecadienal 2,13-Octadecadienal, (2E,13Z)- | [Molecular Formula]
C18H32O | [MDL Number]
MFCD09055121 | [MOL File]
99577-57-8.mol | [Molecular Weight]
264.45 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C18H32O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19/h5-6,16-18H,2-4,7-15H2,1H3/b6-5-,17-16+ | [InChIKey]
NCFULMZVHNTQOK-RAPDCGKPSA-N | [SMILES]
C(=O)/C=C/CCCCCCCCC/C=C\CCCC |
| Hazard Information | Back Directory | [Uses]
Sex phermone produced by the female hornet moth, Sesia apiformis. | [Application]
(E,Z)-2,13-octadecadienal is a key component of female sex pheromones in various moths (such as sugarcane leafminer, leafhopper moth, and tree bee), and is used for monitoring and trapping agricultural pests. | [Definition]
ChEBI: 2E,13Z-Octadecadienal is a fatty aldehyde. |
|
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
|