2-Chloro-3-fluoro-5-(trifluoromethyl)pyridine
|
|
|
- CAS-Nr.
- 72600-67-0
- Englisch Name:
- 2-Chloro-3-fluoro-5-(trifluoromethyl)pyridine
- Synonyma:
- 2-Chloro-3-fluoro-5-(trifluoromethyl);Chloro-3-fluoro-5-(trifluoromethyl)pyridine;2-Chloro-3-fluoro-5-(trifluoromethyl)pyridine;Pyridine, 2-chloro-3-fluoro-5-(trifluoromethyl)-
- CBNumber:
- CB02503662
- Summenformel:
- C6H2ClF4N
- Molgewicht:
- 199.53
- MOL-Datei:
- 72600-67-0.mol
|
2-Chloro-3-fluoro-5-(trifluoromethyl)pyridine Eigenschaften
- Siedepunkt:
- 157.4±35.0 °C(Predicted)
- Dichte
- 1.507±0.06 g/cm3(Predicted)
- storage temp.
- 2-8°C
- pka
- -2.76±0.10(Predicted)
- Aussehen
- Colorless to light yellow Liquid
- InChI
- InChI=1S/C6H2ClF4N/c7-5-4(8)1-3(2-12-5)6(9,10)11/h1-2H
- InChIKey
- WZQQLMSKDLDZEL-UHFFFAOYSA-N
- SMILES
- C1(Cl)=NC=C(C(F)(F)F)C=C1F
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| RIDADR |
1993 |
|
|
| HazardClass |
3 |
|
|
| PackingGroup |
Ⅲ |
|
|
| HS Code |
2933399990 |
|
|
| Bildanzeige (GHS) |

|
| Alarmwort |
Warnung |
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H226 |
Flüssigkeit und Dampf entzündbar. |
Entzündbare Flüssigkeiten |
Kategorie 3 |
Warnung |
|
|
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
src="/GHS07.jpg" width="20" height="20" /> |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
src="/GHS07.jpg" width="20" height="20" /> |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizität (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
src="/GHS07.jpg" width="20" height="20" /> |
|
|
| Sicherheit |
| P210 |
Von Hitze, heißen Oberflächen, Funken, offenen Flammen und anderen Zündquellenarten fernhalten. Nicht rauchen. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P303+P361+P353 |
BEI BERÜHRUNG MIT DER HAUT (oder dem Haar): Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abwaschen oder duschen. |
|
2-Chloro-3-fluoro-5-(trifluoromethyl)pyridine Chemische Eigenschaften,Einsatz,Produktion Methoden
2-Chloro-3-fluoro-5-(trifluoromethyl)pyridine Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-Chloro-3-fluoro-5-(trifluoromethyl)pyridine Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 49)Lieferanten
72600-67-0()Verwandte Suche:
- 2-Chloro-3-fluoro-5-(trifluoromethyl)pyridine
- 2-Chloro-3-fluoro-5-(trifluoromethyl)
- Chloro-3-fluoro-5-(trifluoromethyl)pyridine
- Pyridine, 2-chloro-3-fluoro-5-(trifluoromethyl)-
- 72600-67-0