AMbroxol hydrochloride iMpurity B
|
|
|
- CAS-Nr.
- 15942-08-2
- Englisch Name:
- AMbroxol hydrochloride iMpurity B
- Synonyma:
- Ambroxol EP impurity B;Ambroxol Impurity B HCl;Ambroxol EP Impurity B HCl;AMbroxol hydrochloride iMpurity B;trans-4-(6,8-Dibromo-1,4-dihydroqui;Ambroxol EP Impurity B ydrochloride;Ambroxol EP Impurity B(hydrochloride);N,N'-Methylene Ambroxol Hydrochloride;Ambroxol Impurity 1(Ambroxol EP Impurity B);Ambroxol Hydrochloride EP Impurity B as Hydrochloride
- CBNumber:
- CB52552362
- Summenformel:
- C14H19Br2ClN2O
- Molgewicht:
- 426.58
- MOL-Datei:
- 15942-08-2.mol
|
AMbroxol hydrochloride iMpurity B Eigenschaften
- storage temp.
- under inert gas (nitrogen or Argon) at 2-8°C
- Löslichkeit
- DMSO (Slightly), Methanol (Slightly), Water (Slightly)
- Aggregatzustand
- Solid
- Farbe
- White to Off-White
- Stabilität:
- Hygroscopic
- InChI
- InChI=1/C14H18Br2N2O.ClH/c15-10-5-9-7-18(8-17-14(9)13(16)6-10)11-1-3-12(19)4-2-11;/h5-6,11-12,17,19H,1-4,7-8H2;1H/t11-,12-;
- InChIKey
- ICLHRFYBPXBCPE-GJTSMBTKNA-N
- SMILES
- BrC1C=C(Br)C=C2CN([C@@H]3CC[C@@H](O)CC3)CNC=12.Cl |&1:9,12,r|
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung |
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitsschädlich bei Verschlucken. |
Akute Toxizität oral |
Kategorie 4 |
Warnung |
src="/GHS07.jpg" width="20" height="20" /> |
P264, P270, P301+P312, P330, P501 |
|
| Sicherheit |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P270 |
Bei Gebrauch nicht essen, trinken oder rauchen. |
| P301+P312 |
BEI VERSCHLUCKEN: Bei Unwohlsein GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
| P330 |
Mund ausspülen. |
| P501 |
Inhalt/Behälter ... (Entsorgungsvorschriften vom Hersteller anzugeben) zuführen. |
|
AMbroxol hydrochloride iMpurity B Chemische Eigenschaften,Einsatz,Produktion Methoden
AMbroxol hydrochloride iMpurity B Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
AMbroxol hydrochloride iMpurity B Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 88)Lieferanten
15942-08-2()Verwandte Suche:
- (1r,4r)-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride
- trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride
- trans-4-(6,8-Dibromo-1,4-dihydroquinazolin-3(2H)-yl)cyclohexanol Hydrochloride
- Cyclohexanol, 4-(6,8-dibromo-1,4-dihydro-3(2H)-quinazolinyl)-, hydrochloride (1:1), trans-
- Ambroxol EP impurity B
- Imp. B(HCl) (EP):as Hydrochloride: trans-4-(6,8-Dibromo-1,4-dihydroquinazolin-3(2H)-yl)-cyclohexanol Hydrochloride
- Ambroxol Hydrochloride Impurity Ⅰ:trans-4-(6,8-Dibromo-1,4-dihydro-3(2H)-quinazolinyl)cyclohexanol
- Ambroxol EP Impurity B HCl
- Ambroxol Impurity 1(Ambroxol EP Impurity B)
- trans-4-(6,8-Dibromo-1,4-dihydroqui
- Cyclohexanol,4-(6,8-dibromo-1,4-dihydro-3(2H)-quinazolinyl)-,monohydrochloride,trans
- trans-4-(6,8-dibromo-1,4-dihydroquinazolin-3(2H)yl)cyclohexa...
- Ambroxol hydrochloride EP Impurity BQ: What is
Ambroxol hydrochloride EP Impurity B Q: What is the CAS Number of
Ambroxol hydrochloride EP Impurity B Q: What is the storage condition of
Ambroxol hydrochloride EP Impurity B Q: What are the applications of
Ambroxol hydrochloride EP Impurity B
- trans-4-(6,8-dibromo-1,4-dihydroquinazolin-3(2H)yl)cyclohexanol
- 4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol,hydrochloride
- Ambroxol EP Impurity B ydrochloride
- Ambroxol Hydrochloride EP Impurity B as Hydrochloride
- Ambroxol Hydrochloride Impurity B(trans-4-(6,8-Didromo-1,4-dihydroquinazolin-3(2H)-yl)-cyclohexanol Hydrochloride)
- Ambroxol EP Impurity B(hydrochloride)
- AMbroxol hydrochloride iMpurity B
- Ambroxol Impurity B HCl
- Ambroxol Hydrochloride Impurity Ⅰ:trans-4-(6,8-Dibromo-1,4-dihydro-3(2H)-quinazolinyl)cyclohexanol
- N,N'-Methylene Ambroxol Hydrochloride
- Ambroxol Impurity 1 (Ambroxol EP Impurity B Hydrochloride)
- 15942-08-2
- C14H19Br2ClN2O
- 42657