다이메틸메톡시크로만올
|
|
다이메틸메톡시크로만올 속성
- 끓는 점
- 329.0±42.0 °C(Predicted)
- 밀도
- 1.106±0.06 g/cm3(Predicted)
- 산도 계수 (pKa)
- 10.59±0.40(Predicted)
- InChI
- InChI=1S/C12H16O3/c1-12(2)5-4-8-6-9(13)11(14-3)7-10(8)15-12/h6-7,13H,4-5H2,1-3H3
- InChIKey
- JXPHIHWXMBYJAU-UHFFFAOYSA-N
- SMILES
- C1(C)(C)OC2=CC(OC)=C(O)C=C2CC1
안전
다이메틸메톡시크로만올 C화학적 특성, 용도, 생산
개요
Dimethylmethoxy chromanol (DMC) is a synthetic molecule with a structure similar to α-Tocopherol (vitamin E) and works as a super potent antioxidant. It is known for not only protecting against reactive oxygen species (ROS) but also against reactive nitrogen species (RNS) (both are evil reactive molecules that cause damage to cells and tissues and are responsible for several mechanisms that trigger skin aging).다이메틸메톡시크로만올 준비 용품 및 원자재
원자재
준비 용품
다이메틸메톡시크로만올 공급 업체
글로벌( 71)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| Beri Pharma Co., Ltd. | +8613417710166 |
sales@zhberi.com | China | 227 | 58 |
| Hebei Yanxi Chemical Co., Ltd. | +8617531190177 |
peter@yan-xi.com | China | 5873 | 58 |
| Hebei Chuanghai Biotechnology Co,.LTD | +86-13131129325 |
sales1@chuanghaibio.com | China | 5872 | 58 |
| Chongqing Zhihe Biopharmaceutical Co., Ltd. | +8618580541567 |
sales@zhswyy.com | China | 303 | 58 |
| Hebei Zhuanglai Chemical Trading Co.,Ltd | +8613343047651 |
admin@zlchemi.com | China | 3002 | 58 |
| Hefei TNJ Chemical Industry Co.,Ltd. | +86-0551-65418679 +8618949832763 |
info@tnjchem.com | China | 2989 | 55 |
| Shanghai Longyu Biotechnology Co., Ltd. | +8619521488211 |
info@longyupharma.com | China | 2534 | 58 |
| Neostar United (Changzhou) Industrial Co., Ltd. | +86-0519-85551759 +8613506123987 |
marketing1@neostarunited.com | China | 9305 | 58 |
| Zhengzhou Alfa Chemical Co.,Ltd | +8618530059196 |
sale04@alfachem.cn | China | 13350 | 58 |
| ANHUI WITOP BIOTECH CO., LTD | +8615255079626 |
eric@witopchemical.com | China | 23555 | 58 |