|
|
| | Ethyl-4-Fluoroindole-2-Carboxylate Basic information |
| Product Name: | Ethyl-4-Fluoroindole-2-Carboxylate | | Synonyms: | Ethyl-4-Fluoroindole-2-Carboxylate;ethyl 4-fluoro-1H-indole-2-carboxylate;4-Fluoro-1H-indol-2-carboxylic acid ethyl ester, 98%;4-Fluoro-1H-indol-2-carboxylic acid ethyl este;1H-Indole-2-carboxylic acid, 4-fluoro-, ethyl ester;4-Fluoro-1H-indole-2-carboxylic acid ethyl ester | | CAS: | 348-32-3 | | MF: | C11H10FNO2 | | MW: | 207.2 | | EINECS: | | | Product Categories: | | | Mol File: | 348-32-3.mol |  |
| | Ethyl-4-Fluoroindole-2-Carboxylate Chemical Properties |
| Melting point | 121 °C | | Boiling point | 345.9±22.0 °C(Predicted) | | density | 1.291±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.41±0.30(Predicted) | | Appearance | Brown to reddish brown Solid | | InChI | InChI=1S/C11H10FNO2/c1-2-15-11(14)10-6-7-8(12)4-3-5-9(7)13-10/h3-6,13H,2H2,1H3 | | InChIKey | ODEXIEZAUJDKKO-UHFFFAOYSA-N | | SMILES | N1C2=C(C(F)=CC=C2)C=C1C(OCC)=O |
| | Ethyl-4-Fluoroindole-2-Carboxylate Usage And Synthesis |
| | Ethyl-4-Fluoroindole-2-Carboxylate Preparation Products And Raw materials |
|