- 2,6-Dichloro-4-nitrophenol
-
- $15.00 / 1KG
-
2021-08-11
- CAS:618-80-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 2,6-Dichloro-4-nitrophenol Basic information |
| Product Name: | 2,6-Dichloro-4-nitrophenol | | Synonyms: | 2,6-dichloro-4-nitro-pheno;2,6-DICHLORO-4-NITROPHENOL;2,6-Dichloro-4-nitro;6-dichloro-4-nitrophenol;2,6-Dichloro-4-nitrophenol, 96% 5GR;2,6-Dichloro-4-nitrophenol, >=99%;4-Nitro-2,6-dichlorophenol;2,6-Dichloro-4-nitrophenol,96% | | CAS: | 618-80-4 | | MF: | C6H3Cl2NO3 | | MW: | 208 | | EINECS: | 210-563-6 | | Product Categories: | Organic Building Blocks;Oxygen Compounds;Phenols | | Mol File: | 618-80-4.mol |  |
| | 2,6-Dichloro-4-nitrophenol Chemical Properties |
| Melting point | 123-126 °C (dec.) | | Boiling point | 285.2±40.0 °C(Predicted) | | density | 1.8220 | | refractive index | 1.5650 (estimate) | | storage temp. | Storage temp. 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.81±0.44(Predicted) | | color | Light orange to Yellow to Green | | BRN | 1245045 | | InChI | 1S/C6H3Cl2NO3/c7-4-1-3(9(11)12)2-5(8)6(4)10/h1-2,10H | | InChIKey | PXSGFTWBZNPNIC-UHFFFAOYSA-N | | SMILES | Oc1c(Cl)cc(cc1Cl)[N+]([O-])=O | | CAS DataBase Reference | 618-80-4(CAS DataBase Reference) | | EPA Substance Registry System | Phenol, 2,6-dichloro-4-nitro- (618-80-4) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36-36/37/39 | | RIDADR | UN 2811 6.1/PG 1 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29089990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2 |
| | 2,6-Dichloro-4-nitrophenol Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Purification Methods | Crystallise the chloronitrophenol from EtOH and dry it in vacuo over anhydrous MgSO4. |
| | 2,6-Dichloro-4-nitrophenol Preparation Products And Raw materials |
| Raw materials | Potassium chlorate | | Preparation Products | 1-(3-(4-AMINO-2,6-DICHLOROPHENOXY)PROPYL)PYRROLIDIN-2-ONE-->2,6-DICHLORO-4-NITROANISOLE-->4-(2-(PIPERIDIN-1-YL)ETHOXY)-3,5-DICHLOROBENZENAMINE-->Benzene, 1,3-dichloro-2-ethoxy-5-nitro--->4-Amino-2,6-dichlorophenol-->4-((1-METHYLPIPERIDIN-3-YL)METHOXY)-3,5-DICHLOROBENZENAMINE-->4-(3-MORPHOLINOPROPOXY)-3,5-DICHLOROBENZENAMINE-->4-(2-(N-BENZYL-N-METHYLAMINO)ETHOXY)-3,5-DICHLOROBENZENAMINE-->4-(1-BENZYLPIPERIDIN-4-YLOXY)-3,5-DICHLOROBENZENAMINE-->4-((4-BENZYLMORPHOLIN-2-YL)METHOXY)-3,5-DICHLOROBENZENAMINE-->TERT-BUTYL 3-(4-AMINO-2,6-DICHLOROPHENOXY)PROPYLCARBAMATE-->4-(2-MORPHOLINOETHOXY)-3,5-DICHLOROBENZENAMINE-->1-(4-AMINO-2,6-DICHLOROPHENOXY)-3-MORPHOLINOPROPAN-2-OL-->4-(2-(N-PHENYL-N-ETHYLAMINO)ETHOXY)-3,5-DICHLOROBENZENAMINE |
|