DI-2-PYRIDYL THIONOCARBONATE manufacturers
|
| | DI-2-PYRIDYL THIONOCARBONATE Basic information |
| | DI-2-PYRIDYL THIONOCARBONATE Chemical Properties |
| Melting point | 94-98 °C(lit.) | | Boiling point | 359℃ | | density | 1.340 | | Fp | 171℃ | | storage temp. | -20°C | | pka | 0.11±0.12(Predicted) | | form | Crystalline Powder | | color | Yellow to brown | | Water Solubility | Soluble in water 9280 g/L). | | BRN | 4314435 | | InChI | InChI=1S/C11H8N2O2S/c16-11(14-9-5-1-3-7-12-9)15-10-6-2-4-8-13-10/h1-8H | | InChIKey | IKYOVSVBLHGFMA-UHFFFAOYSA-N | | SMILES | C(=S)(OC1=NC=CC=C1)OC1=NC=CC=C1 | | CAS DataBase Reference | 96989-50-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | F | 4.4-10-21 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | DI-2-PYRIDYL THIONOCARBONATE Usage And Synthesis |
| Chemical Properties | Yellow to brown crystalline powder | | Uses | Di-2-pyridyl thionocarbonate is used in the synthesis of 10-des(carbamoyloxy)-10-isothiocyanatoporfiromycin. It is also used as a substitute of thiophosgene, in the preparation of isothiocyanate. |
| | DI-2-PYRIDYL THIONOCARBONATE Preparation Products And Raw materials |
|