- Methyltriacetoxysilane
-
- $8.00 / 1KG
-
2025-09-25
- CAS:4253-34-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | Methyltriacetoxysilane Basic information |
| | Methyltriacetoxysilane Chemical Properties |
| Melting point | 40-45 °C(lit.) | | Boiling point | 94-95 °C9 mm Hg(lit.) | | density | 1.20 g/mL at 20 °C(lit.) | | vapor pressure | 0.053-26Pa at 20-25℃ | | refractive index | 1.52-1.522 | | Fp | 185 °F | | solubility | soluble in Methanol | | form | solid | | Specific Gravity | 1.175 | | color | White or Colorless to Almost white or Almost colorless | | Odor | Acrid odor | | Water Solubility | 1000g/L at 20℃ | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Sensitive | Moisture Sensitive | | BRN | 1788668 | | InChI | 1S/C7H12O6Si/c1-5(8)11-14(4,12-6(2)9)13-7(3)10/h1-4H3 | | InChIKey | TVJPBVNWVPUZBM-UHFFFAOYSA-N | | SMILES | CC(=O)O[Si](C)(OC(C)=O)OC(C)=O | | LogP | -2.4 at 20℃ | | CAS DataBase Reference | 4253-34-3(CAS DataBase Reference) | | NIST Chemistry Reference | Methyltriacetoxysilane(4253-34-3) | | EPA Substance Registry System | Silanetriol, 1-methyl-, 1,1,1-triacetate (4253-34-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN1759 | | WGK Germany | 2 | | RTECS | VV4500000 | | F | 9-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
| | Methyltriacetoxysilane Usage And Synthesis |
| Chemical Properties | Methyltriacetoxysilane (MTAC) is a clear to yellowish liquid with acrid odor of acetic acid (vinegar). It hydrolyzes in the presence of moisture (acetic acid is released) to form silanols, which can react with themselves to pro-duce siloxanes or bind to inorganic substrates. | | Uses | Methyltriacetoxysilane is used as a silane coupling agent. | | Flammability and Explosibility | Not classified | | Toxics Screening Level | The initial threshold screening level (ITSL) for methyltriacetoxysilane (CASRN 4253-34-3) remains at 0.1 μg/m3 based on an annual averaging time. |
| | Methyltriacetoxysilane Preparation Products And Raw materials |
|