S-b-aminoisobutyric acid manufacturers
- S-b-aminoisobutyric acid
-
- $5.00 / 1KG
-
2025-09-25
- CAS:4249-19-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- S-b-aminoisobutyric acid
-
- $10.00 / 1Kg/Bag
-
2021-11-24
- CAS:4249-19-8
- Min. Order: 1Kg/Bag
- Purity: 99%
- Supply Ability: 20 Tons
|
| | S-b-aminoisobutyric acid Basic information |
| Product Name: | S-b-aminoisobutyric acid | | Synonyms: | S-3-Aminoisobutyric acid;S-b-aminoisobutyric acid;Propanoic acid, 3-aMino-2-Methyl-, (2S)-;(S)-3-AMino-2-Methylpropanoic acid;(+)-a-Methyl--alanine;(+)-α-Methyl-β-alanine;-Methyl-β(+)-&alpha | | CAS: | 4249-19-8 | | MF: | C4H9NO2 | | MW: | 103.12 | | EINECS: | | | Product Categories: | | | Mol File: | 4249-19-8.mol |  |
| | S-b-aminoisobutyric acid Chemical Properties |
| Melting point | 179 °C | | Boiling point | 223.6±23.0 °C(Predicted) | | density | 1.105±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 3.69±0.16(Predicted) | | color | Pale Yellow to Light Beige | | Optical Rotation | [α]/D 13±2°, c = 1 in 0.5 M HCl | | InChI | InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 | | InChIKey | QCHPKSFMDHPSNR-VKHMYHEASA-N | | SMILES | C(O)(=O)[C@@H](C)CN |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | S-b-aminoisobutyric acid Usage And Synthesis |
| Uses | (+)-α-Methyl-β-alanine is a reactant for the chemoenzymatic assembly of cryptophycins as potent anticancer therapeutics. | | Definition | ChEBI: (S)-3-aminoisobutyric acid is a beta-amino acid and a 3-aminoisobutyric acid. It has a role as a human metabolite. It is a conjugate acid of a (S)-3-aminoisobutyrate. It is an enantiomer of a (R)-3-aminoisobutyric acid. It is a tautomer of a (S)-3-aminoisobutyric acid zwitterion. | | IC 50 | Human Endogenous Metabolite |
| | S-b-aminoisobutyric acid Preparation Products And Raw materials |
|