4-((4,7,7-Trimethyl-3-oxo-bicyclo(2.2.2)hept-2-ylidene)methyl)benzenes ulfonic acid manufacturers
|
| | 4-((4,7,7-Trimethyl-3-oxo-bicyclo(2.2.2)hept-2-ylidene)methyl)benzenes ulfonic acid Basic information |
| Product Name: | 4-((4,7,7-Trimethyl-3-oxo-bicyclo(2.2.2)hept-2-ylidene)methyl)benzenes ulfonic acid | | Synonyms: | 4-((4,7,7-Trimethyl-3-oxo-bicyclo(2.2.2)hept-2-ylidene)methyl)benzenes ulfonic acid;BENZENESULPHONICACID,4-(4,7,7,-TRIMETHYL-3-OXO-BICYCLO(2.;Benzenesulfonic acid, 4-[(4,7,7-trimethyl-3-oxobicyclo[2.2.1]hept-2-ylidene)methyl]-;Benzylidene camphor sulfonic acid Solution, 100μg/mL;(Z)-4-((4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptan-2-ylidene)methyl)benzenesulfonicacid;4-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzenesulfonic acid;Benzylidene camphor sulfonic acid Solution;Benzylidene?Camphor?Sulfonic?Acid/4-[(4,7,7-Trimethyl-3-oxobicyclo[2.2.1]hept-2-ylidene)methyl]benzenesulfonic?acid 56039-58-8 | | CAS: | 56039-58-8 | | MF: | C17H20O4S | | MW: | 320.4 | | EINECS: | | | Product Categories: | | | Mol File: | 56039-58-8.mol |  |
| | 4-((4,7,7-Trimethyl-3-oxo-bicyclo(2.2.2)hept-2-ylidene)methyl)benzenes ulfonic acid Chemical Properties |
| density | 1.305±0.06 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | -0+-.0.50(Predicted) | | color | White to Pale Beige | | Stability: | Light Sensitive | | Major Application | environmental | | Cosmetics Ingredients Functions | UV FILTER LIGHT STABILIZER UV ABSORBER | | InChI | InChI=1S/C17H20O4S/c1-16(2)14-8-9-17(16,3)15(18)13(14)10-11-4-6-12(7-5-11)22(19,20)21/h4-7,10,14H,8-9H2,1-3H3,(H,19,20,21) | | InChIKey | KKJKXQYVUVWWJP-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC=C(C=C2C(=O)C3(C)C(C)(C)C2CC3)C=C1 | | LogP | 0.128 (est) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-((4,7,7-Trimethyl-3-oxo-bicyclo(2.2.2)hept-2-ylidene)methyl)benzenes ulfonic acid Usage And Synthesis |
| Uses | Benzylidene Camphor Sulfonic Acid, also known as Mexoryl SL, is a benzylidene camphor derivative and a common sunscreen ingredient used to filter out UVA rays. |
| | 4-((4,7,7-Trimethyl-3-oxo-bicyclo(2.2.2)hept-2-ylidene)methyl)benzenes ulfonic acid Preparation Products And Raw materials |
|