|
|
| | GLYCOCHOLIC ACID SODIUM SALT Basic information |
| Product Name: | GLYCOCHOLIC ACID SODIUM SALT | | Synonyms: | glycocholatesodium;glycocholatesodiumsalt;sodiuM 2-((4R)-4-((3R,7R,10S,12S,13R,17R)-3,7,12-trihydroxy-10,13-diMethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanaMido)acetate;taurodeoxycholate hydrate;Sodium Glycocholate (anhydrous );Glycine, N-[(3a,5b,7a,12a)-3,7,12-trihydroxy-24-oxocholan-24-yl]-,sodiuM salt (1:1);monosodiumglycocholicacid;n-choloyl-glycinmonosodiumsalt | | CAS: | 863-57-0 | | MF: | C26H42NNaO6 | | MW: | 487.6 | | EINECS: | 212-730-9 | | Product Categories: | Mutagenesis Research Chemicals;Bile Acids;Detergents;Biochemistry;Steroids | | Mol File: | 863-57-0.mol |  |
| | GLYCOCHOLIC ACID SODIUM SALT Chemical Properties |
| Melting point | 210-215 °C (subl.)(lit.) | | refractive index | 30 ° (C=1, H2O) | | storage temp. | Inert atmosphere,2-8°C | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | pka | 3.8 | | form | Solid | | color | White to Off-White | | Water Solubility | water: 200mg/mL ethanol: soluble | | Merck | 4494 | | Stability: | Hygroscopic | | InChIKey | OABYVIYXWMZFFJ-SEUIPJRTNA-M | | SMILES | [Na+].N(CC(=O)[O-])C(=O)CCC(C1C2(C(C3C(C4(C(CC3O)CC(CC4)O)C)CC2O)CC1)C)C | | CAS DataBase Reference | 863-57-0(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | MB9265100 | | F | 3-9 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | GLYCOCHOLIC ACID SODIUM SALT Usage And Synthesis |
| Chemical Properties | Light Green Solid | | Uses | Glycocholic Acid Sodium Salt is a biochemical formed by the conjugation of cholic acid (C432600) with glycine (G615990). | | Definition | ChEBI: Sodium glycocholate is a bile salt. It contains a glycocholate. | | Biological Activity | Glycocholic acid (GCA) is involved in the emulsification of fats. Glycocholic acid sodium (GAS) salt is one of the important cholic acid salts in the pharmaceutical industry used to prepare mixed micelles (MMs). | | Purification Methods | Dissolve it in EtOH, filter it and concentrated to crystallisation, and recrystallise from a little EtOH. It also crystallises from 95% EtOH/Et2O. [Beilstein 3 IV 573.] |
| | GLYCOCHOLIC ACID SODIUM SALT Preparation Products And Raw materials |
|