|
|
| | 3-Chlorobenzenesulfonyl chloride Basic information |
| | 3-Chlorobenzenesulfonyl chloride Chemical Properties |
| Melting point | 21°C | | Boiling point | 102-104 °C/1 mmHg (lit.) | | density | 1.499 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.568(lit.) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Liquid | | color | Clear yellow | | Sensitive | Moisture Sensitive | | BRN | 2937139 | | InChI | InChI=1S/C6H4Cl2O2S/c7-5-2-1-3-6(4-5)11(8,9)10/h1-4H | | InChIKey | OINWZUJVEXUHCC-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=CC(Cl)=C1 | | CAS DataBase Reference | 2888-06-4(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Chlorobenzenesulfonyl chloride(2888-06-4) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 2 | | RTECS | DB8925500 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3-Chlorobenzenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | Clear yellow liquid |
| | 3-Chlorobenzenesulfonyl chloride Preparation Products And Raw materials |
|