| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | Avenanthramideb Basic information |
| Product Name: | Avenanthramideb | | Synonyms: | N-[4′-Hydroxy-3′-methoxy-(E)-cinnamoyl]-5-hydroxyanthranilic acid;5-Hydroxy-2-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propenyl]amino}benzoic acid;Avenanthramide Bf;Avenanthramideb | | CAS: | | | MF: | | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File | ![Avenanthramideb Structure]() |
| | Avenanthramideb Chemical Properties |
| storage temp. | 2-8°C | | InChI | 1S/C17H15NO6/c1-24-15-8-10(2-6-14(15)20)3-7-16(21)18-13-5-4-11(19)9-12(13)17(22)23/h2-9,19-20H,1H3,(H,18,21)(H,22,23)/b7-3+ | | InChIKey | JXFZHMCSCYADIX-XVNBXDOJSA-N | | SMILES | OC1=CC=C(NC(/C=C/C2=CC=C(O)C(OC)=C2)=O)C(C(O)=O)=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Avenanthramideb Usage And Synthesis |
| Uses | Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| | Avenanthramideb Preparation Products And Raw materials |
|