- Bavachalcone
-
- $44.00 / 1mg
-
2026-04-21
- CAS:28448-85-3
- Min. Order:
- Purity: 99.38%
- Supply Ability: 10g
- Bavachalcone
-
- $0.00 / 5mg
-
2023-02-24
- CAS:28448-85-3
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Bavachalcone Basic information |
| Product Name: | Bavachalcone | | Synonyms: | (E)-1-[2,4-Dihydroxy-5-(3-methyl-2-butenyl)phenyl]-3-(4-hydroxyphenyl)-2-propen-1-one;Bavachalcone;Broussochalcone B;(2E)-1-[2,4-Dihydroxy-5-(3-methyl-2-buten-1-yl)phenyl]-3-(4-hydroxyphenyl)-2-propen-1-one;BAVACHALCONE; BROUSSOCHALCONE B;Roussochalcone B;2-Propen-1-one,1-[2,4-dihydroxy-5-(3-methyl-2-buten-1-yl)phenyl]-3-(4-hydroxyphenyl)-, (2E)-;Bavachalcone, >98% | | CAS: | 28448-85-3 | | MF: | C20H20O4 | | MW: | 324.37 | | EINECS: | | | Product Categories: | | | Mol File: | 28448-85-3.mol |  |
| | Bavachalcone Chemical Properties |
| Melting point | 168-169℃ | | Boiling point | 549.6±50.0 °C(Predicted) | | density | 1.243 | | storage temp. | Store at -20°C | | solubility | DMSO: soluble | | form | powder | | pka | 7.58±0.50(Predicted) | | color | Yellow-orange | | Major Application | food and beverages | | InChI | InChI=1S/C20H20O4/c1-13(2)3-7-15-11-17(20(24)12-19(15)23)18(22)10-6-14-4-8-16(21)9-5-14/h3-6,8-12,21,23-24H,7H2,1-2H3/b10-6+ | | InChIKey | BLZGPHNVMRXDCB-UXBLZVDNSA-N | | SMILES | C(C1=CC(C/C=C(/C)\C)=C(O)C=C1O)(=O)/C=C/C1=CC=C(O)C=C1 | | CAS DataBase Reference | 28448-85-3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Bavachalcone Usage And Synthesis |
| Description | Bavachalcone has biological activities such as dilating blood vessels, increasing myocardial contractility, antibacterial, antitumor, estrogen-like, and treating vitiligo. | | Uses | Bavachalcone soluble liquid can be used on rice, apples and various vegetables, and can also be used to prevent and control tomato mosaic virus disease, soybean mosaic virus disease, tobacco mosaic virus disease and other important plant diseases. | | Definition | ChEBI: Bavachalcone is a member of chalcones. | | Biological Activity | Bavachalcone (Bavachalcone) is a compound isolated from Psoraleae, which is widely used in traditional Chinese medicine and has activities such as antibiotics and anticancer. | | target | AMPK | SOD | MEK | ERK | Akt | NF-kB |
| | Bavachalcone Preparation Products And Raw materials |
|