|
|
| | 2-Amino-4-(2,4-dimethyl-phenyl)-thiophene-3-carboxylic acid ethyl ester Basic information |
| | 2-Amino-4-(2,4-dimethyl-phenyl)-thiophene-3-carboxylic acid ethyl ester Chemical Properties |
| Boiling point | 397.8±42.0 °C(Predicted) | | density | 1.179±0.06 g/cm3(Predicted) | | form | solid | | pka | -0.04±0.14(Predicted) | | InChI | 1S/C15H17NO2S/c1-4-18-15(17)13-12(8-19-14(13)16)11-6-5-9(2)7-10(11)3/h5-8H,4,16H2,1-3H3 | | InChIKey | XBGBEIKHJJZZLM-UHFFFAOYSA-N | | SMILES | O=C(OCC)C1=C(N)SC=C1C(C(C)=C2)=CC=C2C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 2-Amino-4-(2,4-dimethyl-phenyl)-thiophene-3-carboxylic acid ethyl ester Usage And Synthesis |
| | 2-Amino-4-(2,4-dimethyl-phenyl)-thiophene-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|