- Diphenylacetic acid
-
- $1.00 / 1kg
-
2026-04-17
- CAS:117-34-0
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 1000
|
| | 2,2-Diphenylacetic acid Basic information |
| | 2,2-Diphenylacetic acid Chemical Properties |
| Melting point | 147-149 °C(lit.) | | Boiling point | 195°C 25mm | | density | 1,257 g/cm3 | | vapor pressure | 0.001Pa at 25℃ | | refractive index | 1.6000 (estimate) | | Fp | 195°C/25mm | | storage temp. | Sealed in dry,Room Temperature | | solubility | 0.13g/l | | pka | 3.94(at 25℃) | | form | Crystalline Powder | | color | White to creamy-white | | PH | 3.8 (H2O, 20℃)(saturated solution) | | Water Solubility | Slightly soluble in water(0.13g/L). | | Merck | 14,3316 | | BRN | 1910978 | | InChI | 1S/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) | | InChIKey | PYHXGXCGESYPCW-UHFFFAOYSA-N | | SMILES | OC(=O)C(c1ccccc1)c2ccccc2 | | LogP | 3.17 at 25℃ | | CAS DataBase Reference | 117-34-0(CAS DataBase Reference) | | NIST Chemistry Reference | Benzeneacetic acid, «alpha»-phenyl-(117-34-0) | | EPA Substance Registry System | Benzeneacetic acid, .alpha.-phenyl- (117-34-0) |
| Hazard Codes | Xi | | Risk Statements | 36/38-36/37/38 | | Safety Statements | 24/25-36/37-26 | | WGK Germany | 2 | | RTECS | AH2515000 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29163900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 | | Toxicity | mouse,LD50,intraperitoneal,500mg/kg (500mg/kg),Farmaco, Edizione Scientifica. Vol. 13, Pg. 286, 1958. |
| | 2,2-Diphenylacetic acid Usage And Synthesis |
| Chemical Properties | white to creamy-white crystalline powder | | Uses | Kinetic resolution of racemic 1-heteroarylalkanols by asymmetric esterification using diphenylacetic acid with pivalic anhydride and a chiral acyl-transfer catalyst is described. Molecular crystal of acridine and diphenylacetic acid and its absolute asymmetric photodecarboxylating condensation generates chirality in a two-component. The activation parameters for the racemization of a series of ortho-alkyl-substituted diphenylacetic acids are determined. | | Definition | ChEBI: A monocarboxylic acid that is acetic acid where the methyl hydrogens have been replaced by two phenyl groups respectively. | | Synthesis Reference(s) | Journal of the American Chemical Society, 69, p. 2325, 1947 DOI: 10.1021/ja01202a023 Synthetic Communications, 17, p. 1919, 1987 DOI: 10.1080/00397918708057804 | | Purification Methods | Crystallise the acid from *benzene, H2O or aqueous 50% EtOH. [Beilstein 9 H 673, 9 IV 2492.] |
| | 2,2-Diphenylacetic acid Preparation Products And Raw materials |
|