4-bromo-5-chloro-2-nitrophenylamine manufacturers
|
| | 4-bromo-5-chloro-2-nitrophenylamine Basic information |
| Product Name: | 4-bromo-5-chloro-2-nitrophenylamine | | Synonyms: | 4-bromo-5-chloro-2-nitrophenylamine;Benzenamine,4-bromo-5-chloro-2-nitro-;2-nitro-4-bromo-5-chloro-aniline;4-Bromo-5-chloro-2-nitroaniline 95%;4-bromo-5-chloro-2-nitrobenzenamine | | CAS: | 827-33-8 | | MF: | C6H4BrClN2O2 | | MW: | 251.47 | | EINECS: | | | Product Categories: | | | Mol File: | 827-33-8.mol |  |
| | 4-bromo-5-chloro-2-nitrophenylamine Chemical Properties |
| Boiling point | 350.5±37.0 °C(Predicted) | | density | 1.909±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | -2.29±0.25(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C6H4BrClN2O2/c7-3-1-6(10(11)12)5(9)2-4(3)8/h1-2H,9H2 | | InChIKey | XXIFMWKGKJWFOH-UHFFFAOYSA-N | | SMILES | C1(N)=CC(Cl)=C(Br)C=C1[N+]([O-])=O |
| | 4-bromo-5-chloro-2-nitrophenylamine Usage And Synthesis |
| | 4-bromo-5-chloro-2-nitrophenylamine Preparation Products And Raw materials |
|