- 2,3,4,5-Tetrafluoroaniline
-
- $35.00 / 1kg
-
2025-09-25
- CAS:5580-80-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2,3,4,5-Tetrafluoroaniline Basic information |
| Product Name: | 2,3,4,5-Tetrafluoroaniline | | Synonyms: | 2,3,4,5-Tetrafluoroa;2,3,4,5-tetrafluoroethane aniline;Benzenamine, 2,3,4,5-tetrafluoro-;2,3,4,5-TETRAFLUOROANILINE;2,3,4,5-TETRAFLUORO-PHENYLAMINE;Aniline, 2,3,4,5-tetrafluoro-;4-flurophenylacetic acid;2,3,4,5-Tetrafluoroaniline 98% | | CAS: | 5580-80-3 | | MF: | C6H3F4N | | MW: | 165.09 | | EINECS: | 276-218-7 | | Product Categories: | Aniline;Amines;C2 to C6;Nitrogen Compounds | | Mol File: | 5580-80-3.mol |  |
| | 2,3,4,5-Tetrafluoroaniline Chemical Properties |
| Melting point | 27-29 °C(lit.) | | Boiling point | 78 °C13 mm Hg(lit.) | | density | 1.4700 (estimate) | | refractive index | 1.4670 to 1.4710 | | Fp | 175 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 1.23±0.10(Predicted) | | form | Powder | | color | White to brown | | InChI | InChI=1S/C6H3F4N/c7-2-1-3(11)5(9)6(10)4(2)8/h1H,11H2 | | InChIKey | BEECAQIHCYTZHC-UHFFFAOYSA-N | | SMILES | C1(N)=CC(F)=C(F)C(F)=C1F | | CAS DataBase Reference | 5580-80-3(CAS DataBase Reference) | | NIST Chemistry Reference | Benzenamine, 2,3,4,5-tetrafluoro-(5580-80-3) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38 | | Safety Statements | 26-27-36/37/39 | | RIDADR | 2810 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | IRRITANT, IRRITANT-HARMFUL | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2921420090 |
| | 2,3,4,5-Tetrafluoroaniline Usage And Synthesis |
| | 2,3,4,5-Tetrafluoroaniline Preparation Products And Raw materials |
|