- Diethyl benzylmalonate
-
- $5.00 / 1kg
-
2025-05-26
- CAS:607-81-8
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 100000
|
| | Diethyl benzylmalonate Basic information |
| | Diethyl benzylmalonate Chemical Properties |
| Boiling point | 162-163 °C/10 mmHg (lit.) | | density | 1.064 g/mL at 25 °C (lit.) | | vapor pressure | 0.26Pa at 25℃ | | refractive index | n20/D 1.486(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol | | pka | 12.56±0.46(Predicted) | | form | Colourless Liquid | | color | Colorless to Almost colorless | | Water Solubility | immiscible | | BRN | 615793 | | InChI | 1S/C14H18O4/c1-3-17-13(15)12(14(16)18-4-2)10-11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3 | | InChIKey | ICZLTZWATFXDLP-UHFFFAOYSA-N | | SMILES | CCOC(=O)C(Cc1ccccc1)C(=O)OCC | | LogP | 2.76 | | CAS DataBase Reference | 607-81-8(CAS DataBase Reference) | | NIST Chemistry Reference | Propanedioic acid, (phenylmethyl)-, diethyl ester(607-81-8) | | EPA Substance Registry System | Propanedioic acid, 2-(phenylmethyl)-, 1,3-diethyl ester (607-81-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29173980 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2 |
| | Diethyl benzylmalonate Usage And Synthesis |
| Chemical Properties | Colourless Liquid | | Uses | Diethyl benzylmalonate was used in the synthesis of macrocyclic ligands and determination of stability constants of their Cu(II), Ni(II) and Co(II) complexes. It was used as starting reagent for the synthesis of 2-benzyl-1,3-propane diol. | | Uses | Diethyl Benzylmalonate (cas# 607-81-8) is a compound useful in organic synthesis. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 31, p. 620, 1966 DOI: 10.1021/jo01340a523 | | General Description | Diethyl benzylmalonate on condensation with 2-amino-benzimidazole yields 3-benzyl-4-hydroxypyrimido[1,2-a]benzimidazole-2-one. |
| | Diethyl benzylmalonate Preparation Products And Raw materials |
|