| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
Enamine |
| Tel: |
(380) 44 537 32 18 |
| Email: |
enamine@enamine.net |
| Company Name: |
Elkimia, Inc. |
| Tel: |
514 241 6586 |
| Email: |
eak@elkimia.com |
|
| | 4-(Aminosulfonyl)benzenesulfonyl chloride Basic information |
| | 4-(Aminosulfonyl)benzenesulfonyl chloride Chemical Properties |
| form | solid | | InChI | 1S/C6H6ClNO4S2/c7-13(9,10)5-1-3-6(4-2-5)14(8,11)12/h1-4H,(H2,8,11,12) | | InChIKey | LLFQHNCOIPUFIJ-UHFFFAOYSA-N | | SMILES | NS(=O)(=O)c1ccc(cc1)S(Cl)(=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-(Aminosulfonyl)benzenesulfonyl chloride Usage And Synthesis |
| | 4-(Aminosulfonyl)benzenesulfonyl chloride Preparation Products And Raw materials |
|