- CARFENTRAZONE-ETHYL
-
- $8.90 / 1KG
-
2026-03-20
- CAS:128639-02-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- CARFENTRAZONE-ETHYL
-
- $29.00 / 1Kg/Bag
-
2020-11-16
- CAS:128639-02-1
- Min. Order: 10Kg/Bag
- Purity: 99%
- Supply Ability: 20 Tons
- CARFENTRAZONE-ETHYL
-
- $1.00 / 1KG
-
2019-07-06
- CAS: 128639-02-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | CARFENTRAZONE-ETHYL Basic information |
| Product Name: | CARFENTRAZONE-ETHYL | | Synonyms: | ETHYL 2-CHLORO-3-[2-CHLORO-4-FLUORO-5-[4-(DIFLUOROMETHYL)-4,5-DIHYDRO-3-METHYL-5-OXO-1H-1,2,4TRIAZOL-1-YL]PHENYL]PROPANOAT;ETHYL-ALPHA,2-DICHLORO-5-[4-(DIFLUOROMETHYL)-4,5-DIHYDRO-3-METHYL-5-OXO-1H-1,2,4-TRIAZOL-1-YL]-4-FLUOROBENZENEPROPANOATE;CARFENTRAZONE-ETHYL;CARFENTRAZON ETHYL;Ethyl 2-chloro-3-[2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]-4-fluorophenyl]propanoate;Aurora (pesticide);Aurora 50wg;Carfentrazone-ethyl [iso:bsi] | | CAS: | 128639-02-1 | | MF: | C15H14Cl2F3N3O3 | | MW: | 412.19 | | EINECS: | 205-516-1 | | Product Categories: | | | Mol File: | 128639-02-1.mol |  |
| | CARFENTRAZONE-ETHYL Chemical Properties |
| Melting point | -22.1° | | Boiling point | bp 760 350-355° | | density | d20 1.457 g/cm3 | | Fp | >110°C | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Methanol (Sparingly) | | pka | -2.26±0.20(Predicted) | | Water Solubility | 21.98mg/L(temperature not stated) | | BRN | 9081231 | | Henry's Law Constant | 3.3×103 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) | | Major Application | agriculture
environmental | | InChI | 1S/C15H14Cl2F3N3O3/c1-3-26-13(24)10(17)4-8-5-12(11(18)6-9(8)16)23-15(25)22(14(19)20)7(2)21-23/h5-6,10,14H,3-4H2,1-2H3 | | InChIKey | MLKCGVHIFJBRCD-UHFFFAOYSA-N | | SMILES | CCOC(=O)C(Cl)Cc1cc(N2N=C(C)N(C(F)F)C2=O)c(F)cc1Cl | | NIST Chemistry Reference | Carfentrazone ethyl(128639-02-1) | | EPA Substance Registry System | Carfentrazone-ethyl (128639-02-1) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN3082 9/PG 3 | | WGK Germany | 2 | | RTECS | DA8343383 | | HS Code | 29339900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 | | Hazardous Substances Data | 128639-02-1(Hazardous Substances Data) | | Toxicity | LD50 in rats (mg/kg): 5143 orally (female); >4000 dermally (Van Saun) |
| | CARFENTRAZONE-ETHYL Usage And Synthesis |
| Uses | Post-emergent herbicide. | | Uses | Carfentrazone-ethyl is a triazolone herbicides and is a derivative of Carfentrazone. Carfentrazone-ethyl was found to be suitable against complex weed flora in wheat. | | Definition | ChEBI: Ethyl 2-chloro-3-{2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]-4-fluorophenyl}propanoate is an ethyl ester resulting from the formal condensation of the carboxy group of 2-chloro-3-{2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]-4-fluorophenyl}propanoic acid with ethanol. It has a role as a proherbicide. |
| | CARFENTRAZONE-ETHYL Preparation Products And Raw materials |
|