|
|
| | 2,6-Dimethylbenzoic acid Basic information |
| Product Name: | 2,6-Dimethylbenzoic acid | | Synonyms: | M-XYLENE-2-CARBOXYLIC ACID;TIMTEC-BB SBB007881;RARECHEM AL BO 0401;VIC-M-XYLYLIC ACID;2,6-dimethyl-benzoicaci;2,6-DIMETHYLBENZOIC ACID;Benzoic acid, 2,6-dimethyl- (7CI,8CI,9CI);Benzoic acid, 2,6-dimethyl- | | CAS: | 632-46-2 | | MF: | C9H10O2 | | MW: | 150.17 | | EINECS: | 211-177-0 | | Product Categories: | Benzoic acid Series;Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals;CARBOXYLICACID;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Benzoic acid | | Mol File: | 632-46-2.mol |  |
| | 2,6-Dimethylbenzoic acid Chemical Properties |
| Melting point | 114-116 °C (lit.) | | Boiling point | 160 °C / 17mmHg | | density | 1.0937 (estimate) | | refractive index | 1.5236 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | pKa: 3.362(25°C) | | form | Crystalline Powder | | color | White to pale cream | | BRN | 1863791 | | InChI | InChI=1S/C9H10O2/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,1-2H3,(H,10,11) | | InChIKey | HCBHQDKBSKYGCK-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(C)C=CC=C1C | | LogP | 2.210 | | CAS DataBase Reference | 632-46-2(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 2,6-dimethyl-(632-46-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | RTECS | DG8734010 | | HS Code | 29163900 |
| | 2,6-Dimethylbenzoic acid Usage And Synthesis |
| Chemical Properties | white to pale cream crystalline powder | | Uses | Benzoic acid derivative used in the preparation of antiinflammatory and antirheumatic agents. A potential geothermal tracer. | | Uses | 2,6-Dimethylbenzoic acid is a benzoic acid derivative used in the preparation of antiinflammatory and antirheumatic agents. And it is also a potential geothermal tracer. | | Definition | ChEBI: A dimethylbenzoic acid in which the two methyl groups are located at positions 2 and 6. | | Synthesis Reference(s) | Tetrahedron, 36, p. 2409, 1980 DOI: 10.1016/0040-4020(80)80219-5 | | General Description | Crystal structure of 2,6-dimethylbenzoic acid was studied by three-dimensional X-ray methods. | | Purification Methods | Steam distil the acid, and crystallise it from EtOH or H2O (m 116.3-116.7o). The N-dimethylamide has m 62-63o (from Et2O). [Beilstein 9 H 531, 9 IV 1798.] |
| | 2,6-Dimethylbenzoic acid Preparation Products And Raw materials |
|