|
|
| Product Name: | 3,4,7,8-Tetramethyl-1,10-phenanthroline | | Synonyms: | 1,2,7,8-Tetramethyl-4,5-diazaphenanthrene;3,4,7,8-TetraMethyl -1,10-phenathroline;3,4,7,8-TetraMethyl-1,10-phenanthroline, 99+% 1GR;3,4,7,8-TETRAMETHYL-1,10-PHENANTHROLINE;TIMTEC-BB SBB008945;3,4,7,8-tetramethyl-10-phenanthroline;3,4,7,8-TETRAMETHYL-1,10-PHENANTHROLINE, 99+%;3,4,7,8-Tetramethyl-1,10-phenaanthroline | | CAS: | 1660-93-1 | | MF: | C16H16N2 | | MW: | 236.31 | | EINECS: | 216-762-4 | | Product Categories: | Electronic Chemicals;Building Blocks;Chemical Synthesis;Heterocyclic Building Blocks;Heterocyclic Building Blocks;N-Containing;Others | | Mol File: | 1660-93-1.mol |  |
| | 3,4,7,8-Tetramethyl-1,10-phenanthroline Chemical Properties |
| Melting point | 277-280 °C(lit.) | | Boiling point | 368.78°C (rough estimate) | | density | 1.0937 (rough estimate) | | refractive index | 1.5635 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in 1,4-dioxane, acetone, dichloromethane, N,N-dimethylformamide, N,N-dimethylacetamide, methanol and hot toluene. | | pka | 6.37±0.10(Predicted) | | form | Fine Crystalline Powder | | color | Light beige | | Water Solubility | 1.512mg/L(25.04 ºC) | | BRN | 171279 | | InChI | InChI=1S/C16H16N2/c1-9-7-17-15-13(11(9)3)5-6-14-12(4)10(2)8-18-16(14)15/h5-8H,1-4H3 | | InChIKey | NPAXPTHCUCUHPT-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=CC(C)=C3C)C(C)=C(C)C=1 | | CAS DataBase Reference | 1660-93-1(CAS DataBase Reference) | | EPA Substance Registry System | 1,10-Phenanthroline, 3,4,7,8-tetramethyl- (1660-93-1) |
| | 3,4,7,8-Tetramethyl-1,10-phenanthroline Usage And Synthesis |
| Description | 3,4,7,8-Tetramethyl-1,10-phenanthroline is used as a metal-chelating agent. For instance, it is used in the synthesis of heteroleptic cationic Ir(III) complex: 3,4,7,8-tetramethyl-1,10-phenanthroline-bis[2-(2’,4’-difluorophenyl)pyridine]iridium(III) hexafluorophosphate. It is used as a ligand to form dinuclear Cu(II) hypocrelin B complexes. It also forms tetraaqua(3,4,7,8-tetramethyl-1,10-phenanthroline-kappa2N,N′)zinc(II) thiosulfate complex with zinc.
| | Reference | Y. Sun, YJ. Hou, QX. Zhou, WH. Lei, JR. Chen, XS. Wang, BW. Zhang, Dinuclear Cu(II) hypocrellin B complexes with enhanced photonuclease activity, Inorganic Chemistry, 2010, vol. 49, pp. 10108-10116
| | Chemical Properties | light beige fine crystalline powder | | Uses | 3,4,7,8-Tetramethyl-1,10-phenanthroline is a metal-chelating agent. |
| | 3,4,7,8-Tetramethyl-1,10-phenanthroline Preparation Products And Raw materials |
|