| Company Name: |
Energy Chemical
|
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(S)-Me-f-KetalPhos CAS:488760-58-3 Package:100MG
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(S)-Me-f-KetalPhos CAS:488760-58-3 Package:100MG Remarks:ALDRICH
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:(S)-Me-f-KetalPhos CAS:488760-58-3
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
CAS:488760-58-3
|
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
| Products Intro: |
|
|
| | 1,1-Bis[(2S,3S,4S,5S)-2,5-dimethyl-3,4-O-isopropylidene-3,4-dihydroxyphospholanyl]ferrocene Basic information |
| Product Name: | 1,1-Bis[(2S,3S,4S,5S)-2,5-dimethyl-3,4-O-isopropylidene-3,4-dihydroxyphospholanyl]ferrocene | | Synonyms: | (S)-Me-f-KetalPhos;1,1-Bis[(2S,3S,4S,5S)-2,5-dimethyl-3,4-O-isopropylidene-3,4-dihydroxyphospholanyl]ferrocene;1,1′-Bis[(3aS,4S,6S,6aS)-tetrahydro-2,2,4,6-tetramethyl-5H-phospholo[3,4-d]-1,3-dioxol-5-yl]ferrocene;(S)-Me-f-KetalPhos | | CAS: | 488760-58-3 | | MF: | C28H40FeO4P2 | | MW: | 558.407322 | | EINECS: | | | Product Categories: | | | Mol File: | 488760-58-3.mol | ![1,1-Bis[(2S,3S,4S,5S)-2,5-dimethyl-3,4-O-isopropylidene-3,4-dihydroxyphospholanyl]ferrocene Structure](CAS/20180808/GIF/488760-58-3.gif) |
| | 1,1-Bis[(2S,3S,4S,5S)-2,5-dimethyl-3,4-O-isopropylidene-3,4-dihydroxyphospholanyl]ferrocene Chemical Properties |
| Melting point | 151.6-158.4 °C | | InChI | 1S/2C14H20O2P.Fe/c2*1-9-12-13(16-14(3,4)15-12)10(2)17(9)11-7-5-6-8-11;/h2*5-10,12-13H,1-4H3;/t2*9-,10-,12+,13+;/m00./s1 | | InChIKey | VMJRCJPLHRKPIW-DYCBUYNASA-N | | SMILES | [Fe].C[C@H]1[C@H]2OC(C)(C)O[C@@H]2[C@H](C)P1[C]3[CH][CH][CH][CH]3.C[C@H]4[C@H]5OC(C)(C)O[C@@H]5[C@H](C)P4[C]6[CH][CH][CH][CH]6 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1,1-Bis[(2S,3S,4S,5S)-2,5-dimethyl-3,4-O-isopropylidene-3,4-dihydroxyphospholanyl]ferrocene Usage And Synthesis |
| | 1,1-Bis[(2S,3S,4S,5S)-2,5-dimethyl-3,4-O-isopropylidene-3,4-dihydroxyphospholanyl]ferrocene Preparation Products And Raw materials |
|