| Company Name: |
Chengdu Feibo Pharm Technology Co., Ltd
|
| Tel: |
+86 028-84641798 15982321820 |
| Email: |
abby@arkpharm.com |
| Products Intro: |
Product Name:ethyl 4-chloro-2-methylquinoline-6-carboxylate
CAS:100375-87-9
Purity:95%+ Package:5g;50g;100g;250g;500g;1kg;5kg
|
| Company Name: |
Nantong MYBio-pharm. Co., Ltd.
|
| Tel: |
0513-85921823 18662920231 |
| Email: |
sales@ntminyanmedical.com |
| Products Intro: |
Product Name:ethyl 4-chloro-2-methylquinoline-6-carboxylate
CAS:100375-87-9
Purity:97 Package:1g m/
|
| Company Name: |
Chengdu Xiaojia Technology Co., Ltd.
|
| Tel: |
15902830537 |
| Email: |
zhanghao@happysyn.com |
| Products Intro: |
Product Name:ethyl 4-chloro-2-methylquinoline-6-carboxylate
CAS:100375-87-9
Purity:97% Package:25g
|
|
| | ethyl 4-chloro-2-methylquinoline-6-carboxylate Basic information |
| | ethyl 4-chloro-2-methylquinoline-6-carboxylate Chemical Properties |
| Melting point | 113-114 °C | | Boiling point | 355.4±37.0 °C(Predicted) | | density | 1.252±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 3.49±0.50(Predicted) | | InChI | 1S/C13H12ClNO2/c1-3-17-13(16)9-4-5-12-10(7-9)11(14)6-8(2)15-12/h4-7H,3H2,1-2H3 | | InChIKey | WWHIKEAYZCGNRF-UHFFFAOYSA-N | | SMILES | O=C(OCC)C1=CC=C2N=C(C)C=C(Cl)C2=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | ethyl 4-chloro-2-methylquinoline-6-carboxylate Usage And Synthesis |
| | ethyl 4-chloro-2-methylquinoline-6-carboxylate Preparation Products And Raw materials |
|